Knowledge

Phenanthrene

Source 📝

816: 323: 184: 36: 27: 45: 512: 865: 608: 887: 517: 516: 663:
Phenanthrene occurs naturally and also is a man-made chemical. Commonly, humans are exposed to phenanthrene through inhalation of cigarette smoke, but there are many routes of exposure. Animal studies have shown that phenanthrene is a potential carcinogen. However, according to IARC, it is not
515: 659:
rings. It is a colorless, crystal-like solid, but can also appear yellow. Phenanthrene is used to make dyes, plastics, pesticides, explosives, and drugs. It has also been used to make bile acids, cholesterol and steroids.
997: 4123: 6338: 518: 901:
is a natural mineral consisting of phenanthrene. It is found in small amounts among a few coal burning sites. Ravatite represents a small group of organic minerals.
2023: 1605: 1544: 2013: 2008: 1529: 842:
converts the other rings into aromatic ones as well. The aromatization of six-membered rings by selenium is not clearly understood, but it does produce
1995: 1516: 621: 5454: 5399: 1587: 6167: 5509: 2035: 1556: 540: 5659: 4293: 2081: 6388: 2096: 2091: 2076: 1661: 6162: 3988: 2165: 2134: 1913: 1903: 1788: 372: 5264: 3185: 2170: 2149: 2144: 1928: 1923: 1918: 1908: 1803: 1798: 1793: 1783: 1449: 815: 5834: 5034: 3778: 898: 533: 6487: 5999: 5929: 5909: 5404: 4571: 4033: 4452: 4008: 109: 3221: 5754: 6232: 6182: 4586: 1290: 5689: 6328: 6137: 5794: 5774: 5734: 4541: 3484: 1068: 6323: 6253: 6152: 5809: 5664: 5294: 5139: 4749: 4376: 4153: 6403: 6187: 5499: 4989: 4664: 823: 5209: 616: 6398: 6112: 5974: 5764: 5729: 1262: 6288: 6227: 5759: 5674: 5644: 5624: 5489: 5484: 4859: 4784: 4427: 4381: 4248: 3509: 1189: 337: 6393: 6353: 6303: 5979: 5779: 5529: 5459: 3948: 3519: 5594: 4487: 4208: 628: 6147: 5989: 5859: 5854: 5669: 5144: 5054: 4644: 4576: 4467: 4043: 3798: 3723: 3178: 2766: 2215: 644: 526: 5904: 6433: 6318: 6217: 6157: 5804: 5599: 5559: 5534: 5444: 4904: 3938: 3868: 3504: 3434: 2757: 880: 5024: 1216:
KovĂĄcs, AdriĂĄna; Vasas, Andrea; Hohmann, Judit (2008). "Natural phenanthrenes and their biological activity".
6423: 6009: 5899: 5519: 5244: 5029: 4974: 4819: 4779: 4611: 4366: 4083: 3933: 876: 6383: 5944: 5389: 6418: 6333: 6308: 6283: 6268: 6192: 6107: 6004: 5964: 5829: 5784: 5549: 5094: 5079: 4944: 4734: 4402: 4158: 3838: 3813: 3783: 3374: 280: 179: 6368: 6313: 6258: 5969: 5889: 5789: 5504: 5469: 5314: 5204: 4919: 4914: 4739: 4699: 4596: 4407: 4371: 4223: 4213: 4068: 3928: 3788: 3738: 3733: 3708: 3668: 3614: 3379: 3369: 3344: 3075: 301: 1021: 6343: 6044: 5849: 5284: 5169: 4849: 4824: 4764: 4621: 4356: 4063: 3843: 3808: 3713: 3404: 3339: 3171: 1283: 795: 756: 687:
Phenanthrene is nearly insoluble in water but is soluble in most low-polarity organic solvents such as
5634: 3898: 247: 6443: 6348: 6202: 6082: 6054: 6024: 5939: 5869: 5824: 5799: 5719: 5619: 5579: 5274: 4894: 4884: 4809: 4333: 4193: 4188: 4168: 3853: 3650: 3629: 3589: 3514: 993: 191: 3334: 6408: 6298: 6278: 6142: 5984: 5894: 5864: 5844: 5739: 5694: 5524: 5434: 5364: 5249: 5239: 5069: 4626: 4566: 4531: 4338: 4318: 4278: 4053: 3923: 3888: 3848: 3599: 3439: 3429: 3359: 2908: 318: 241: 5874: 6378: 6237: 6087: 6029: 5954: 5934: 5654: 5604: 5464: 5429: 5369: 5299: 4854: 4601: 4581: 4313: 4233: 4128: 4088: 4058: 3993: 3878: 3863: 3773: 3763: 3424: 3349: 3304: 1675: 481: 3639: 6482: 6117: 5839: 5589: 5569: 5544: 5494: 5409: 5384: 5339: 5309: 5289: 5259: 5224: 5179: 5154: 5129: 5014: 4939: 4719: 4412: 4348: 4148: 3873: 3793: 3479: 3454: 3231: 3226: 2625: 1439: 831: 675:. The compound with a phenanthrene skeleton and nitrogens at the 4 and 5 positions is known as 1050: 6453: 6039: 5994: 5709: 5679: 5649: 5584: 5564: 5479: 5474: 5439: 5394: 5379: 5374: 5354: 5344: 5279: 5269: 5199: 5149: 4669: 4472: 4048: 4003: 3833: 3823: 3569: 3494: 3289: 3251: 2969: 2964: 2686: 2620: 1276: 3499: 6222: 6172: 6122: 6102: 6092: 5949: 5924: 5639: 5629: 5514: 5329: 5324: 5254: 5039: 4839: 4799: 4729: 4694: 4649: 4616: 4482: 4457: 4437: 4258: 4218: 4178: 4143: 4073: 3828: 3698: 3673: 3211: 2954: 2949: 2944: 2939: 2862: 2204: 2003: 1225: 765: 692: 289: 57: 44: 8: 6428: 6413: 6059: 6034: 6019: 6014: 5744: 5699: 5684: 5574: 5554: 5449: 5334: 5319: 5164: 5109: 5099: 5064: 4829: 4704: 4679: 4591: 4447: 4432: 4417: 4238: 4183: 3953: 3803: 3748: 3619: 3534: 3394: 3319: 2892: 2532: 958: 161: 75: 6438: 5089: 4273: 3464: 1229: 322: 183: 141: 85: 6177: 6127: 6097: 5959: 5749: 5539: 5424: 5359: 5349: 5114: 5044: 5009: 5004: 4984: 4979: 4924: 4834: 4684: 4546: 4536: 4442: 4228: 4173: 4103: 4023: 3918: 3818: 3753: 3678: 3524: 3389: 3324: 3309: 3010: 2750: 2719: 2676: 1534: 1524: 568: 121: 986: 5914: 5234: 5119: 5084: 5049: 4994: 4949: 4864: 4844: 4794: 4789: 4759: 4744: 4654: 4561: 4497: 4462: 4288: 4163: 4038: 3963: 3943: 3858: 3693: 3688: 3634: 3544: 3449: 3409: 3364: 3246: 3241: 3206: 3071: 2847: 2610: 2582: 2425: 2185: 2180: 2018: 1539: 1241: 1185: 1155: 1139: 1123: 1107: 1091: 843: 743: 734: 4909: 1237: 6448: 6293: 6263: 6207: 6132: 6064: 5819: 5769: 5614: 5419: 5194: 5189: 5134: 5124: 4899: 4709: 4689: 4659: 4556: 4492: 4477: 4308: 4263: 4253: 4243: 4138: 4118: 4113: 4098: 4093: 3973: 3968: 3908: 3893: 3883: 3728: 3718: 3584: 3574: 3474: 3469: 3444: 3384: 3236: 3195: 3061: 2857: 2852: 2735: 2574: 1233: 1181: 1177: 1159: 1143: 1127: 1111: 1095: 872: 858: 469: 395: 3564: 6358: 6049: 5884: 5879: 5174: 5159: 5104: 5059: 5019: 4969: 4934: 4929: 4874: 4869: 4804: 4754: 4674: 4502: 4386: 4361: 4323: 4298: 4283: 4268: 4203: 4078: 4028: 4018: 3998: 3958: 3768: 3758: 3743: 3539: 3459: 3329: 3299: 3284: 3279: 2724: 2681: 2590: 2464: 1429: 1419: 936: 835: 583: 210: 730:
Reactions of phenanthrene typically occur at the 9 and 10 positions, including:
269: 6363: 6273: 6212: 5304: 5214: 5184: 4959: 4814: 4551: 4328: 4198: 4013: 3983: 3683: 3579: 3354: 3216: 3111: 3106: 3020: 2989: 2923: 2918: 2811: 2655: 2650: 2615: 2566: 2472: 1444: 1434: 916: 791: 676: 599: 3163: 1008:
Peter Atkins, J. D. P., Atkins' Physical Chemistry. Oxford: 2010. P. 443.
6476: 6373: 6074: 5919: 5814: 5609: 4999: 4964: 4954: 4889: 4879: 4769: 4606: 4422: 4133: 4108: 3978: 3624: 3609: 3594: 3489: 3419: 3399: 3314: 2743: 2332: 2139: 2129: 1625: 924: 910: 769: 696: 458: 448: 172: 35: 1204: 5414: 4774: 4526: 4303: 3903: 3703: 3554: 3549: 3414: 3269: 3056: 3005: 2887: 2872: 2806: 2438: 2402: 2071: 2061: 1970: 1960: 1950: 1491: 1481: 1471: 1245: 928: 854: 827: 751: 738: 719: 715: 539: 3913: 3559: 3529: 3294: 3030: 3015: 2913: 2790: 2486: 2443: 2416: 2350: 2313: 2232: 2086: 2066: 2053: 1985: 1980: 1975: 1965: 1955: 1942: 1773: 1506: 1501: 1496: 1486: 1476: 1463: 1299: 920: 704: 552: 26: 714:
Phenanthrene is fluorescent under ultraviolet light, exhibiting a large
525: 6197: 5724: 5074: 2959: 2928: 2816: 2545: 2433: 2237: 2124: 2114: 2043: 1778: 1600: 1595: 1570: 1424: 1414: 953: 932: 787: 774: 700: 532: 417: 192: 152: 919:. They have been reported from flowering plants, mainly in the family 3152: 3142: 3137: 3066: 2974: 2882: 2826: 2550: 2288: 2257: 2247: 2242: 2119: 1847: 1635: 1630: 1409: 668: 16:
Polycyclic aromatic hydrocarbon composed of three fused benzene rings
598:
Except where otherwise noted, data are given for materials in their
3604: 3274: 3147: 3101: 3091: 3081: 3051: 3035: 3025: 2979: 2867: 2821: 2780: 2714: 2709: 2519: 2511: 2503: 2383: 2375: 2367: 2318: 2303: 2293: 2283: 2278: 2252: 2175: 1887: 1867: 1717: 1645: 1640: 1620: 948: 839: 747: 498: 230: 664:
identified as a probable, possible or confirmed human carcinogen.
108: 3264: 3116: 3096: 3086: 2785: 2671: 2645: 2495: 2340: 2273: 1872: 1862: 1852: 1742: 1732: 1722: 1610: 1576: 1564: 1378: 1368: 1358: 1348: 760: 708: 688: 656: 438: 256: 834:, which closes the central ring onto an existing aromatic ring. 346:
InChI=1S/C14H10/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1-10H
2984: 2877: 2540: 2459: 2359: 2308: 1882: 1877: 1857: 1817: 1757: 1752: 1747: 1737: 1727: 1688: 1615: 1393: 1388: 1383: 1373: 1363: 1353: 1318: 1268: 864: 853:
Phenanthrene can also be obtained photochemically from certain
356:
InChI=1/C14H10/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1-10H
3132: 2224: 2190: 2106: 672: 590: 132: 98: 306: 221: 886: 790:. A classic and well established explanation is based on 667:
Phenanthrene's three fused rings are angled as in the
6339:
Erlenmeyer–Plöchl azlactone and amino-acid synthesis
2765: 786:Phenanthrene is more stable than its linear isomer 1215: 5400:Divinylcyclopropane-cycloheptadiene rearrangement 1174:Comprehensive Organic Name Reactions and Reagents 6474: 1069:"Spectrum [Phenanthrene] | AAT Bioquest" 268: 3193: 1317: 794:. A novel theory invokes so-called stabilizing 514: 84: 5660:Thermal rearrangement of aromatic hydrocarbons 4294:Thermal rearrangement of aromatic hydrocarbons 6389:Lectka enantioselective beta-lactam synthesis 3649: 3179: 2751: 1284: 6168:Inverse electron-demand Diels–Alder reaction 3989:Heterogeneous metal catalyzed cross-coupling 998:Institute for Occupational Safety and Health 915:Phenanthrene derivatives occur in plants as 5510:Lobry de Bruyn–Van Ekenstein transformation 1016: 1014: 768:to 2 and 3-phenanthrenesulfonic acids with 3186: 3172: 2758: 2744: 1291: 1277: 321: 182: 160: 6000:Petrenko-Kritschenko piperidone synthesis 5455:Fritsch–Buttenberg–Wiechell rearrangement 288: 6163:Intramolecular Diels–Alder cycloaddition 1176:. Vol. 49. 2010. pp. 215–219. 1162:(1973); Vol. 41, p. 41 (1961). 1146:(1943); Vol. 16, p. 63 (1936). 1130:(1955); Vol. 28, p. 19 (1948). 1114:(1963); Vol. 34, p. 31 (1954). 1098:(1963); Vol. 34, p. 76 (1954). 1011: 982: 980: 978: 976: 974: 885: 863: 810:is a classic way to make phenanthrenes. 808:Bardhan–Sengupta phenanthrene synthesis 317: 246: 6475: 6183:Metal-centered cycloaddition reactions 5835:Debus–Radziszewski imidazole synthesis 3779:Bodroux–Chichibabin aldehyde synthesis 1209: 1031:. U.S. Environmental Protection Agency 935:, as well as in the lower plant class 893: 798:between the C4 and C5 hydrogen atoms. 682: 557:171 Â°C (340 Â°F; 444 K) 463:332 Â°C (630 Â°F; 605 K) 453:101 Â°C (214 Â°F; 374 K) 173: 6329:Diazoalkane 1,3-dipolar cycloaddition 6233:Vinylcyclopropane (5+2) cycloaddition 6138:Diazoalkane 1,3-dipolar cycloaddition 5910:Hurd–Mori 1,2,3-thiadiazole synthesis 5405:Dowd–Beckwith ring-expansion reaction 4572:Hurd–Mori 1,2,3-thiadiazole synthesis 3648: 3485:LFER solvent coefficients (data page) 3167: 2739: 1272: 971: 349:Key: YNPNZTXNASCQKK-UHFFFAOYSA-N 140: 5140:Sharpless asymmetric dihydroxylation 4377:Methoxymethylenetriphenylphosphorane 5265:Allen–Millar–Trippett rearrangement 871:Other synthesis routes include the 824:electrophilic aromatic substitution 359:Key: YNPNZTXNASCQKK-UHFFFAOYAC 259: 229: 13: 6404:Nitrone-olefin (3+2) cycloaddition 6399:Niementowski quinazoline synthesis 6188:Nitrone-olefin (3+2) cycloaddition 6113:Azide-alkyne Huisgen cycloaddition 5975:Niementowski quinazoline synthesis 5730:Azide-alkyne Huisgen cycloaddition 5035:Meerwein–Ponndorf–Verley reduction 4587:Leimgruber–Batcho indole synthesis 781: 510: 14: 6499: 6228:Trimethylenemethane cycloaddition 5930:Johnson–Corey–Chaykovsky reaction 5795:Cadogan–Sundberg indole synthesis 5775:Bohlmann–Rahtz pyridine synthesis 5735:Baeyer–Emmerling indole synthesis 4542:Cadogan–Sundberg indole synthesis 4034:Johnson–Corey–Chaykovsky reaction 1256: 746:to 9,10-dihydrophenanthrene with 671:, rather than straight as in the 6488:Polycyclic aromatic hydrocarbons 6324:Cook–Heilbron thiazole synthesis 6153:Hexadehydro Diels–Alder reaction 5980:Niementowski quinoline synthesis 5810:Cook–Heilbron thiazole synthesis 5755:Bischler–Möhlau indole synthesis 5665:Tiffeneau–Demjanov rearrangement 5295:Baker–Venkataraman rearrangement 4453:Horner–Wadsworth–Emmons reaction 4124:Mizoroki-Heck vs. Reductive Heck 4009:Horner–Wadsworth–Emmons reaction 3520:Neighbouring group participation 2767:Polycyclic aromatic hydrocarbons 1298: 814: 606: 407: 43: 34: 25: 5860:Fiesselmann thiophene synthesis 5690:Westphalen–LettrĂ© rearrangement 5670:Vinylcyclopropane rearrangement 5500:Kornblum–DeLaMare rearrangement 5145:Epoxidation of allylic alcohols 5055:Noyori asymmetric hydrogenation 4990:Kornblum–DeLaMare rearrangement 4665:Gallagher–Hollander degradation 1238:10.1016/j.phytochem.2007.12.005 1198: 1165: 1149: 645:polycyclic aromatic hydrocarbon 602:(at 25 Â°C , 100 kPa). 6319:Chichibabin pyridine synthesis 5805:Chichibabin pyridine synthesis 5765:Blum–Ittah aziridine synthesis 5600:Ring expansion and contraction 3869:Cross dehydrogenative coupling 1182:10.1002/9780470638859.conrr049 1172:"Bardhan Sengupta Synthesis". 1133: 1117: 1101: 1085: 1061: 1043: 1002: 401: 1: 6289:Bischler–Napieralski reaction 6247:Heterocycle forming reactions 5900:Hemetsberger indole synthesis 5760:Bischler–Napieralski reaction 5675:Wagner–Meerwein rearrangement 5645:Sommelet–Hauser rearrangement 5625:Seyferth–Gilbert homologation 5490:Ireland–Claisen rearrangement 5485:Hofmann–Martius rearrangement 5245:2,3-sigmatropic rearrangement 4860:Corey–Winter olefin synthesis 4785:Barton–McCombie deoxygenation 4428:Corey–Winter olefin synthesis 4382:Seyferth–Gilbert homologation 4249:Seyferth–Gilbert homologation 964: 380:C1=CC=C2C(=C1)C=CC3=CC=CC=C32 6394:Lehmstedt–Tanasescu reaction 6354:Gabriel–Colman rearrangement 6309:Bucherer carbazole synthesis 6304:Borsche–Drechsel cyclization 6284:Bernthsen acridine synthesis 6269:Bamberger triazine synthesis 6254:Algar–Flynn–Oyamada reaction 5965:Nazarov cyclization reaction 5830:De Kimpe aziridine synthesis 5785:Bucherer carbazole synthesis 5780:Borsche–Drechsel cyclization 5550:Nazarov cyclization reaction 5530:Meyer–Schuster rearrangement 5460:Gabriel–Colman rearrangement 5210:Wolffenstein–Böters reaction 5095:Reduction of nitro compounds 4945:Grundmann aldehyde synthesis 4750:Algar–Flynn–Oyamada reaction 4159:Olefin conversion technology 4154:Nozaki–Hiyama–Kishi reaction 3949:Gabriel–Colman rearrangement 3839:Claisen-Schmidt condensation 3784:Bouveault aldehyde synthesis 923:, and a few in the families 904: 801: 759:to 9-bromophenanthrene with 737:to phenanthrenequinone with 725: 655:, consisting of three fused 7: 6369:Hantzsch pyridine synthesis 6148:Enone–alkene cycloadditions 5970:Nenitzescu indole synthesis 5890:Hantzsch pyridine synthesis 5855:Ferrario–Ackermann reaction 5505:Kowalski ester homologation 5470:Halogen dance rearrangement 5315:Benzilic acid rearrangement 4740:Akabori amino-acid reaction 4700:Von Braun amide degradation 4645:Barbier–Wieland degradation 4597:Nenitzescu indole synthesis 4577:Kharasch–Sosnovsky reaction 4468:Julia–Kocienski olefination 4372:Kowalski ester homologation 4069:Kowalski ester homologation 4044:Julia–Kocienski olefination 3799:Cadiot–Chodkiewicz coupling 3724:Aza-Baylis–Hillman reaction 3669:Acetoacetic ester synthesis 3380:Dynamic binding (chemistry) 3370:Conrotatory and disrotatory 3345:Charge remote fragmentation 942: 10: 6504: 6434:Robinson–Gabriel synthesis 6384:Kröhnke pyridine synthesis 6218:Retro-Diels–Alder reaction 6158:Imine Diels–Alder reaction 5945:Kröhnke pyridine synthesis 5560:Newman–Kwart rearrangement 5535:Mislow–Evans rearrangement 5445:Fischer–Hepp rearrangement 5390:Di-π-methane rearrangement 5170:Stephen aldehyde synthesis 4905:Eschweiler–Clarke reaction 4622:Williamson ether synthesis 3939:Fujiwara–Moritani reaction 3844:Combes quinoline synthesis 3809:Carbonyl olefin metathesis 3510:More O'Ferrall–Jencks plot 3435:Grunwald–Winstein equation 3405:Electron-withdrawing group 3340:Catalytic resonance theory 908: 757:Electrophilic halogenation 6444:Urech hydantoin synthesis 6424:Pomeranz–Fritsch reaction 6349:Fischer oxazole synthesis 6246: 6083:1,3-Dipolar cycloaddition 6073: 6055:Urech hydantoin synthesis 6025:Reissert indole synthesis 6010:Pomeranz–Fritsch reaction 5940:Knorr quinoline synthesis 5870:Fischer oxazole synthesis 5800:Camps quinoline synthesis 5720:1,3-Dipolar cycloaddition 5708: 5620:Semipinacol rearrangement 5595:Ramberg–BĂ€cklund reaction 5580:Piancatelli rearrangement 5520:McFadyen–Stevens reaction 5275:Alpha-ketol rearrangement 5223: 5030:McFadyen–Stevens reaction 4975:Kiliani–Fischer synthesis 4895:Elbs persulfate oxidation 4820:Bouveault–Blanc reduction 4780:Baeyer–Villiger oxidation 4718: 4635: 4612:Schotten–Baumann reaction 4515: 4488:Ramberg–BĂ€cklund reaction 4395: 4367:Kiliani–Fischer synthesis 4347: 4209:Ramberg–BĂ€cklund reaction 4194:Pinacol coupling reaction 4189:Piancatelli rearrangement 4084:Liebeskind–Srogl coupling 3934:Fujimoto–Belleau reaction 3657: 3651:List of organic reactions 3515:Negative hyperconjugation 3260: 3202: 3125: 3044: 2998: 2901: 2840: 2799: 2773: 2702: 2664: 2638: 2603: 2559: 2531: 2494: 2485: 2452: 2424: 2415: 2395: 2358: 2349: 2331: 2266: 2223: 2214: 2203: 2158: 2105: 2052: 2034: 1994: 1941: 1896: 1840: 1816: 1766: 1710: 1687: 1674: 1654: 1586: 1555: 1515: 1462: 1402: 1341: 1306: 1022:"Phenanthrene Fact Sheet" 994:GESTIS Substance Database 596: 561: 492: 388: 368: 333: 68: 56: 51: 42: 33: 24: 6419:Pictet–Spengler reaction 6334:Einhorn–Brunner reaction 6299:Boger pyridine synthesis 6193:Oxo-Diels–Alder reaction 6108:Aza-Diels–Alder reaction 6005:Pictet–Spengler reaction 5905:Hofmann–Löffler reaction 5895:Hegedus indole synthesis 5865:Fischer indole synthesis 5740:Bartoli indole synthesis 5695:Willgerodt rearrangement 5525:McLafferty rearrangement 5435:Ferrier carbocyclization 5250:2,3-Wittig rearrangement 5240:1,2-Wittig rearrangement 5080:Parikh–Doering oxidation 5070:Oxygen rebound mechanism 4735:Adkins–Peterson reaction 4627:Yamaguchi esterification 4567:Hegedus indole synthesis 4532:Bartoli indole synthesis 4403:Bamford–Stevens reaction 4319:Weinreb ketone synthesis 4279:Stork enamine alkylation 4054:Knoevenagel condensation 3924:Ferrier carbocyclization 3814:Castro–Stephens coupling 3440:Hammett acidity function 3430:Free-energy relationship 3375:Curtin–Hammett principle 3360:Conformational isomerism 2933:-Benzopyrene(Olympicene) 6379:Knorr pyrrole synthesis 6314:Bucherer–Bergs reaction 6259:Allan–Robinson reaction 6238:Wagner-Jauregg reaction 6030:Ring-closing metathesis 5955:Larock indole synthesis 5935:Knorr pyrrole synthesis 5790:Bucherer–Bergs reaction 5655:Stieglitz rearrangement 5635:SkattebĂžl rearrangement 5605:Ring-closing metathesis 5465:Group transfer reaction 5430:Favorskii rearrangement 5370:Cornforth rearrangement 5300:Bamberger rearrangement 5205:Wolff–Kishner reduction 5025:Markó–Lam deoxygenation 4920:Fleming–Tamao oxidation 4915:Fischer–Tropsch process 4602:Oxymercuration reaction 4582:Knorr pyrrole synthesis 4408:Barton–Kellogg reaction 4314:Wagner-Jauregg reaction 4234:Ring-closing metathesis 4224:Reimer–Tiemann reaction 4214:Rauhut–Currier reaction 4129:Nef isocyanide reaction 4089:Malonic ester synthesis 4059:Knorr pyrrole synthesis 3994:High dilution principle 3929:Friedel–Crafts reaction 3864:Cross-coupling reaction 3789:Bucherer–Bergs reaction 3774:Blanc chloromethylation 3764:Blaise ketone synthesis 3739:Baylis–Hillman reaction 3734:Barton–Kellogg reaction 3709:Allan–Robinson reaction 3615:Woodward–Hoffmann rules 3350:Charge-transfer complex 796:hydrogen–hydrogen bonds 482:Magnetic susceptibility 6344:Feist–Benary synthesis 6118:Bradsher cycloaddition 6088:4+4 Photocycloaddition 6045:Simmons–Smith reaction 5990:PaternĂČ–BĂŒchi reaction 5850:Feist–Benary synthesis 5840:Dieckmann condensation 5590:Pummerer rearrangement 5570:Oxy-Cope rearrangement 5545:Myers allene synthesis 5495:Jacobsen rearrangement 5410:Electrocyclic reaction 5385:Demjanov rearrangement 5340:Buchner ring expansion 5310:Beckmann rearrangement 5290:Aza-Cope rearrangement 5285:Arndt–Eistert reaction 5260:Alkyne zipper reaction 5180:Transfer hydrogenation 5155:Sharpless oxyamination 5130:Selenoxide elimination 5015:Lombardo methylenation 4940:Griesbaum coozonolysis 4850:Corey–Itsuno reduction 4825:Boyland–Sims oxidation 4765:Angeli–Rimini reaction 4413:Boord olefin synthesis 4357:Arndt–Eistert reaction 4349:Homologation reactions 4149:Nitro-Mannich reaction 4064:Kolbe–Schmitt reaction 3874:Cross-coupling partner 3794:Buchner ring expansion 3714:Arndt–Eistert reaction 3480:Kinetic isotope effect 3227:Rearrangement reaction 2626:1,3,5-Triheptylbenzene 890: 868: 832:diphosphorus pentoxide 822:This process involves 521: 6203:Pauson–Khand reaction 6040:Sharpless epoxidation 5995:Pechmann condensation 5875:FriedlĂ€nder synthesis 5825:Davis–Beirut reaction 5680:Wallach rearrangement 5650:Stevens rearrangement 5585:Pinacol rearrangement 5565:Overman rearrangement 5480:Hofmann rearrangement 5475:Hayashi rearrangement 5440:Ferrier rearrangement 5395:Dimroth rearrangement 5380:Curtius rearrangement 5375:Criegee rearrangement 5355:Claisen rearrangement 5345:Carroll rearrangement 5280:Amadori rearrangement 5270:Allylic rearrangement 5150:Sharpless epoxidation 4885:Dess–Martin oxidation 4810:Bohn–Schmidt reaction 4670:Hofmann rearrangement 4473:Kauffmann olefination 4396:Olefination reactions 4334:Wurtz–Fittig reaction 4169:Palladium–NHC complex 4049:Kauffmann olefination 4004:Homologation reaction 3854:Corey–House synthesis 3834:Claisen rearrangement 3630:Yukawa–Tsuno equation 3590:Swain–Lupton equation 3570:Spherical aromaticity 3505:Möbius–HĂŒckel concept 3290:Aromatic ring current 3252:Substitution reaction 2909:Benzacephenanthrylene 2621:1,3,5-Triethylbenzene 1205:Ravatite Mineral Data 1158:, Coll. Vol. 5, 1142:, Coll. Vol. 2, 1126:, Coll. Vol. 3, 1110:, Coll. Vol. 4, 1094:, Coll. Vol. 4, 889: 883:, as depicted below: 867: 520: 6409:Paal–Knorr synthesis 6279:Barton–Zard reaction 6223:Staudinger synthesis 6173:Ketene cycloaddition 6143:Diels–Alder reaction 6123:Cheletropic reaction 6103:Alkyne trimerisation 5985:Paal–Knorr synthesis 5950:Kulinkovich reaction 5925:Jacobsen epoxidation 5845:Diels–Alder reaction 5640:Smiles rearrangement 5630:Sigmatropic reaction 5515:Lossen rearrangement 5365:Corey–Fuchs reaction 5330:Boekelheide reaction 5325:Bergmann degradation 5255:Achmatowicz reaction 5040:Methionine sulfoxide 4840:Clemmensen reduction 4800:Bergmann degradation 4730:Acyloin condensation 4695:Strecker degradation 4650:Bergmann degradation 4617:Ullmann condensation 4483:Peterson olefination 4458:Hydrazone iodination 4438:Elimination reaction 4339:Zincke–Suhl reaction 4259:Sonogashira coupling 4219:Reformatsky reaction 4179:Peterson olefination 4144:Nierenstein reaction 4074:Kulinkovich reaction 3889:Diels–Alder reaction 3849:Corey–Fuchs reaction 3829:Claisen condensation 3699:Alkyne trimerisation 3674:Acyloin condensation 3640:ÎŁ-bishomoaromaticity 3600:Thorpe–Ingold effect 3212:Elimination reaction 2024:Isopropylcyclohexene 1606:Perhydrophenanthrene 1545:Isopropylcyclohexane 766:Aromatic sulfonation 718:. It can be used in 693:carbon tetrachloride 647:(PAH) with formula C 503:(fire diamond) 58:Preferred IUPAC name 6429:Prilezhaev reaction 6414:Pellizzari reaction 6093:(4+3) cycloaddition 6060:Van Leusen reaction 6035:Robinson annulation 6020:Pschorr cyclization 6015:Prilezhaev reaction 5745:Bergman cyclization 5700:Wolff rearrangement 5685:Weerman degradation 5575:Pericyclic reaction 5555:Neber rearrangement 5450:Fries rearrangement 5335:Brook rearrangement 5320:Bergman cyclization 5165:Staudinger reaction 5110:Rosenmund reduction 5100:Reductive amination 5065:Oppenauer oxidation 4855:Corey–Kim oxidation 4830:Cannizzaro reaction 4705:Weerman degradation 4680:Isosaccharinic acid 4592:Mukaiyama hydration 4448:Hofmann elimination 4433:Dehydrohalogenation 4418:Chugaev elimination 4239:Robinson annulation 4184:Pfitzinger reaction 3954:Gattermann reaction 3899:Wulff–Dötz reaction 3879:Dakin–West reaction 3804:Carbonyl allylation 3749:Bergman cyclization 3535:Kennedy J. P. Orton 3455:Hammond's postulate 3425:Flippin–Lodge angle 3395:Electromeric effect 3320:Beta-silicon effect 3305:Baker–Nathan effect 2893:Tricyclobutabenzene 2720:Alicyclic compounds 2533:Tetramethylbenzenes 1230:2008PChem..69.1084K 894:Natural occurrences 777:to diphenylaldehyde 683:Physical Properties 470:Solubility in water 425: g·mol 122:Beilstein Reference 21: 6178:McCormack reaction 6128:Conia-ene reaction 5960:Madelung synthesis 5750:Biginelli reaction 5540:Mumm rearrangement 5425:Favorskii reaction 5360:Cope rearrangement 5350:Chan rearrangement 5115:Rubottom oxidation 5045:Miyaura borylation 5010:Lipid peroxidation 5005:Lindgren oxidation 4985:Kornblum oxidation 4980:Kolbe electrolysis 4925:Fukuyama reduction 4835:Carbonyl reduction 4685:Marker degradation 4547:Diazonium compound 4537:Boudouard reaction 4516:Carbon-heteroatom 4443:Grieco elimination 4229:Rieche formylation 4174:Passerini reaction 4104:Meerwein arylation 4024:Hydroxymethylation 3919:Favorskii reaction 3819:Chan rearrangement 3754:Biginelli reaction 3679:Aldol condensation 3525:2-Norbornyl cation 3500:Möbius aromaticity 3495:Markovnikov's rule 3390:Effective molarity 3335:BĂŒrgi–Dunitz angle 3325:Bicycloaromaticity 2677:Cyclopropenylidene 2014:Methylcyclopentene 2004:Methylcyclopropene 1535:Methylcyclopentane 1525:Methylcyclopropane 891: 869: 629:Infobox references 522: 19: 6470: 6469: 6466: 6465: 6462: 6461: 6454:Wohl–Aue reaction 6098:6+4 Cycloaddition 5915:Iodolactonization 5235:1,2-rearrangement 5200:Wohl–Aue reaction 5120:Sabatier reaction 5085:Pinnick oxidation 5050:Mozingo reduction 4995:Leuckart reaction 4950:Haloform reaction 4865:Criegee oxidation 4845:Collins oxidation 4795:Benkeser reaction 4790:Bechamp reduction 4760:Andrussow process 4745:Alcohol oxidation 4655:Edman degradation 4562:Haloform reaction 4511: 4510: 4498:Takai olefination 4463:Julia olefination 4289:Takai olefination 4164:Olefin metathesis 4039:Julia olefination 3964:Grignard reaction 3944:Fukuyama coupling 3859:Coupling reaction 3824:Chan–Lam coupling 3694:Alkyne metathesis 3689:Alkane metathesis 3545:Phosphaethynolate 3450:George S. Hammond 3410:Electronic effect 3365:Conjugated system 3247:Stereospecificity 3242:Stereoselectivity 3207:Addition reaction 3196:organic reactions 3161: 3160: 3072:Hexabenzocoronene 2955:Benzofluoranthene 2950:Benzofluoranthene 2945:Benzofluoranthene 2940:Benzofluoranthene 2863:Benzophenanthrene 2733: 2732: 2698: 2697: 2634: 2633: 2611:Hexamethylbenzene 2599: 2598: 2481: 2480: 2426:Trimethylbenzenes 2411: 2410: 2327: 2326: 2199: 2198: 2186:Cyclododecatriene 2181:Cyclooctatetraene 2019:Methylcyclohexene 2009:Methylcyclobutene 1996:Alkylcycloalkenes 1937: 1936: 1812: 1811: 1670: 1669: 1540:Methylcyclohexane 1530:Methylcyclobutane 1517:Alkylcycloalkanes 1458: 1457: 1156:Organic Syntheses 1140:Organic Syntheses 1124:Organic Syntheses 1108:Organic Syntheses 1092:Organic Syntheses 987:Record of CAS RN 826:using a tethered 744:Organic reduction 735:Organic oxidation 637:Chemical compound 635: 634: 488:−127.9·10 cm/mol 302:CompTox Dashboard 110:Interactive image 6495: 6449:Wenker synthesis 6439:StollĂ© synthesis 6294:Bobbitt reaction 6264:Auwers synthesis 6208:Povarov reaction 6133:Cyclopropanation 6071: 6070: 6065:Wenker synthesis 5820:Darzens reaction 5770:Bobbitt reaction 5615:Schmidt reaction 5420:Enyne metathesis 5195:Whiting reaction 5190:Wharton reaction 5135:Shapiro reaction 5125:Sarett oxidation 5090:PrĂ©vost reaction 4900:Emde degradation 4710:Wohl degradation 4690:Ruff degradation 4660:Emde degradation 4557:Grignard reagent 4493:Shapiro reaction 4478:McMurry reaction 4345: 4344: 4309:Ullmann reaction 4274:StollĂ© synthesis 4264:Stetter reaction 4254:Shapiro reaction 4244:Sakurai reaction 4139:Negishi coupling 4119:Minisci reaction 4114:Michael reaction 4099:McMurry reaction 4094:Mannich reaction 3974:Hammick reaction 3969:Grignard reagent 3909:Enyne metathesis 3894:Doebner reaction 3884:Darzens reaction 3729:Barbier reaction 3719:Auwers synthesis 3646: 3645: 3620:Woodward's rules 3585:Superaromaticity 3575:Spiroaromaticity 3475:Inductive effect 3470:Hyperconjugation 3445:Hammett equation 3385:Edwards equation 3237:Regioselectivity 3188: 3181: 3174: 3165: 3164: 3062:Diindenoperylene 2970:Dibenzanthracene 2965:Dibenzanthracene 2960:trans-Bicalicene 2760: 2753: 2746: 2737: 2736: 2690:-Propenylbenzene 2492: 2491: 2422: 2421: 2356: 2355: 2347: 2346: 2221: 2220: 2212: 2211: 1897:Branched alkynes 1838: 1837: 1767:Branched alkenes 1708: 1707: 1685: 1684: 1588:Polycycloalkanes 1573:(bicycloheptane) 1567:(bicyclopentane) 1403:Branched alkanes 1339: 1338: 1315: 1314: 1293: 1286: 1279: 1270: 1269: 1265:at scorecard.org 1250: 1249: 1224:(5): 1084–1110. 1213: 1207: 1202: 1196: 1195: 1169: 1163: 1153: 1147: 1137: 1131: 1121: 1115: 1105: 1099: 1089: 1083: 1082: 1080: 1079: 1065: 1059: 1058: 1047: 1041: 1040: 1038: 1036: 1026: 1018: 1009: 1006: 1000: 984: 873:Haworth reaction 859:Mallory reaction 818: 619: 613: 610: 609: 542: 535: 528: 513: 433:Colorless solid 424: 409: 403: 396:Chemical formula 326: 325: 310: 308: 292: 272: 261: 250: 233: 211:Gmelin Reference 194: 186: 175: 164: 144: 112: 88: 47: 38: 29: 22: 18: 6503: 6502: 6498: 6497: 6496: 6494: 6493: 6492: 6473: 6472: 6471: 6458: 6359:Gewald reaction 6242: 6069: 6050:Skraup reaction 5885:Graham reaction 5880:Gewald reaction 5711: 5704: 5226: 5219: 5175:Swern oxidation 5160:Stahl oxidation 5105:Riley oxidation 5060:Omega oxidation 5020:Luche reduction 4970:Jones oxidation 4935:Glycol cleavage 4930:Ganem oxidation 4875:Davis oxidation 4870:Dakin oxidation 4805:Birch reduction 4755:Amide reduction 4721: 4714: 4675:Hooker reaction 4637: 4631: 4519: 4517: 4507: 4503:Wittig reaction 4391: 4387:Wittig reaction 4362:Hooker reaction 4343: 4324:Wittig reaction 4299:Thorpe reaction 4284:Suzuki reaction 4269:Stille reaction 4204:Quelet reaction 4079:Kumada coupling 4029:Ivanov reaction 4019:Hydrovinylation 3999:Hiyama coupling 3959:Glaser coupling 3769:Blaise reaction 3759:Bingel reaction 3744:Benary reaction 3661: 3659: 3653: 3644: 3540:Passive binding 3460:Homoaromaticity 3310:Baldwin's rules 3285:Antiaromaticity 3280:Anomeric effect 3256: 3198: 3192: 3162: 3157: 3126:General classes 3121: 3040: 2994: 2897: 2836: 2795: 2769: 2764: 2734: 2729: 2725:Petroleum jelly 2694: 2682:Phenylacetylene 2660: 2630: 2595: 2591:Isobutylbenzene 2555: 2527: 2477: 2448: 2407: 2391: 2345: 2323: 2262: 2206: 2195: 2154: 2101: 2048: 2030: 1990: 1933: 1892: 1834: 1826: 1820: 1808: 1762: 1704: 1697: 1691: 1680: 1678: 1666: 1650: 1582: 1579:(bicyclodecane) 1551: 1511: 1454: 1420:3-Methylpentane 1398: 1335: 1327: 1321: 1310: 1308: 1302: 1297: 1259: 1254: 1253: 1214: 1210: 1203: 1199: 1192: 1171: 1170: 1166: 1154: 1150: 1138: 1134: 1122: 1118: 1106: 1102: 1090: 1086: 1077: 1075: 1067: 1066: 1062: 1049: 1048: 1044: 1034: 1032: 1029:archive.epa.gov 1024: 1020: 1019: 1012: 1007: 1003: 985: 972: 967: 945: 937:Marchantiophyta 917:phenanthrenoids 913: 907: 896: 877:Wagner-Meerwein 847: 836:Dehydrogenation 804: 784: 782:Canonical forms 728: 685: 654: 650: 638: 631: 626: 625: 624:  ?) 615: 611: 607: 603: 586: 577: 571: 547: 546: 545: 544: 537: 530: 523: 519: 511: 485: 472: 422: 412: 406: 398: 384: 381: 376: 375: 364: 361: 360: 357: 351: 350: 347: 341: 340: 329: 311: 304: 295: 275: 262: 236: 213: 204: 167: 147: 124: 115: 102: 91: 78: 64: 63: 17: 12: 11: 5: 6501: 6491: 6490: 6485: 6468: 6467: 6464: 6463: 6460: 6459: 6457: 6456: 6451: 6446: 6441: 6436: 6431: 6426: 6421: 6416: 6411: 6406: 6401: 6396: 6391: 6386: 6381: 6376: 6371: 6366: 6364:Hantzsch ester 6361: 6356: 6351: 6346: 6341: 6336: 6331: 6326: 6321: 6316: 6311: 6306: 6301: 6296: 6291: 6286: 6281: 6276: 6274:Banert cascade 6271: 6266: 6261: 6256: 6250: 6248: 6244: 6243: 6241: 6240: 6235: 6230: 6225: 6220: 6215: 6213:Prato reaction 6210: 6205: 6200: 6195: 6190: 6185: 6180: 6175: 6170: 6165: 6160: 6155: 6150: 6145: 6140: 6135: 6130: 6125: 6120: 6115: 6110: 6105: 6100: 6095: 6090: 6085: 6079: 6077: 6068: 6067: 6062: 6057: 6052: 6047: 6042: 6037: 6032: 6027: 6022: 6017: 6012: 6007: 6002: 5997: 5992: 5987: 5982: 5977: 5972: 5967: 5962: 5957: 5952: 5947: 5942: 5937: 5932: 5927: 5922: 5917: 5912: 5907: 5902: 5897: 5892: 5887: 5882: 5877: 5872: 5867: 5862: 5857: 5852: 5847: 5842: 5837: 5832: 5827: 5822: 5817: 5812: 5807: 5802: 5797: 5792: 5787: 5782: 5777: 5772: 5767: 5762: 5757: 5752: 5747: 5742: 5737: 5732: 5727: 5722: 5716: 5714: 5706: 5705: 5703: 5702: 5697: 5692: 5687: 5682: 5677: 5672: 5667: 5662: 5657: 5652: 5647: 5642: 5637: 5632: 5627: 5622: 5617: 5612: 5607: 5602: 5597: 5592: 5587: 5582: 5577: 5572: 5567: 5562: 5557: 5552: 5547: 5542: 5537: 5532: 5527: 5522: 5517: 5512: 5507: 5502: 5497: 5492: 5487: 5482: 5477: 5472: 5467: 5462: 5457: 5452: 5447: 5442: 5437: 5432: 5427: 5422: 5417: 5412: 5407: 5402: 5397: 5392: 5387: 5382: 5377: 5372: 5367: 5362: 5357: 5352: 5347: 5342: 5337: 5332: 5327: 5322: 5317: 5312: 5307: 5305:Banert cascade 5302: 5297: 5292: 5287: 5282: 5277: 5272: 5267: 5262: 5257: 5252: 5247: 5242: 5237: 5231: 5229: 5225:Rearrangement 5221: 5220: 5218: 5217: 5215:Zinin reaction 5212: 5207: 5202: 5197: 5192: 5187: 5185:Wacker process 5182: 5177: 5172: 5167: 5162: 5157: 5152: 5147: 5142: 5137: 5132: 5127: 5122: 5117: 5112: 5107: 5102: 5097: 5092: 5087: 5082: 5077: 5072: 5067: 5062: 5057: 5052: 5047: 5042: 5037: 5032: 5027: 5022: 5017: 5012: 5007: 5002: 4997: 4992: 4987: 4982: 4977: 4972: 4967: 4962: 4960:Hydrogenolysis 4957: 4952: 4947: 4942: 4937: 4932: 4927: 4922: 4917: 4912: 4910:Étard reaction 4907: 4902: 4897: 4892: 4887: 4882: 4877: 4872: 4867: 4862: 4857: 4852: 4847: 4842: 4837: 4832: 4827: 4822: 4817: 4815:Bosch reaction 4812: 4807: 4802: 4797: 4792: 4787: 4782: 4777: 4772: 4767: 4762: 4757: 4752: 4747: 4742: 4737: 4732: 4726: 4724: 4720:Organic redox 4716: 4715: 4713: 4712: 4707: 4702: 4697: 4692: 4687: 4682: 4677: 4672: 4667: 4662: 4657: 4652: 4647: 4641: 4639: 4633: 4632: 4630: 4629: 4624: 4619: 4614: 4609: 4604: 4599: 4594: 4589: 4584: 4579: 4574: 4569: 4564: 4559: 4554: 4552:Esterification 4549: 4544: 4539: 4534: 4529: 4523: 4521: 4513: 4512: 4509: 4508: 4506: 4505: 4500: 4495: 4490: 4485: 4480: 4475: 4470: 4465: 4460: 4455: 4450: 4445: 4440: 4435: 4430: 4425: 4420: 4415: 4410: 4405: 4399: 4397: 4393: 4392: 4390: 4389: 4384: 4379: 4374: 4369: 4364: 4359: 4353: 4351: 4342: 4341: 4336: 4331: 4329:Wurtz reaction 4326: 4321: 4316: 4311: 4306: 4301: 4296: 4291: 4286: 4281: 4276: 4271: 4266: 4261: 4256: 4251: 4246: 4241: 4236: 4231: 4226: 4221: 4216: 4211: 4206: 4201: 4199:Prins reaction 4196: 4191: 4186: 4181: 4176: 4171: 4166: 4161: 4156: 4151: 4146: 4141: 4136: 4131: 4126: 4121: 4116: 4111: 4106: 4101: 4096: 4091: 4086: 4081: 4076: 4071: 4066: 4061: 4056: 4051: 4046: 4041: 4036: 4031: 4026: 4021: 4016: 4014:Hydrocyanation 4011: 4006: 4001: 3996: 3991: 3986: 3984:Henry reaction 3981: 3976: 3971: 3966: 3961: 3956: 3951: 3946: 3941: 3936: 3931: 3926: 3921: 3916: 3911: 3906: 3901: 3896: 3891: 3886: 3881: 3876: 3871: 3866: 3861: 3856: 3851: 3846: 3841: 3836: 3831: 3826: 3821: 3816: 3811: 3806: 3801: 3796: 3791: 3786: 3781: 3776: 3771: 3766: 3761: 3756: 3751: 3746: 3741: 3736: 3731: 3726: 3721: 3716: 3711: 3706: 3701: 3696: 3691: 3686: 3684:Aldol reaction 3681: 3676: 3671: 3665: 3663: 3658:Carbon-carbon 3655: 3654: 3643: 3642: 3637: 3635:Zaitsev's rule 3632: 3627: 3622: 3617: 3612: 3607: 3602: 3597: 3592: 3587: 3582: 3580:Steric effects 3577: 3572: 3567: 3562: 3557: 3552: 3547: 3542: 3537: 3532: 3527: 3522: 3517: 3512: 3507: 3502: 3497: 3492: 3487: 3482: 3477: 3472: 3467: 3462: 3457: 3452: 3447: 3442: 3437: 3432: 3427: 3422: 3417: 3412: 3407: 3402: 3397: 3392: 3387: 3382: 3377: 3372: 3367: 3362: 3357: 3352: 3347: 3342: 3337: 3332: 3327: 3322: 3317: 3312: 3307: 3302: 3297: 3292: 3287: 3282: 3277: 3272: 3267: 3261: 3258: 3257: 3255: 3254: 3249: 3244: 3239: 3234: 3232:Redox reaction 3229: 3224: 3219: 3217:Polymerization 3214: 3209: 3203: 3200: 3199: 3191: 3190: 3183: 3176: 3168: 3159: 3158: 3156: 3155: 3150: 3145: 3140: 3135: 3129: 3127: 3123: 3122: 3120: 3119: 3114: 3112:Trinaphthylene 3109: 3107:Superphenalene 3104: 3099: 3094: 3089: 3084: 3079: 3069: 3064: 3059: 3054: 3048: 3046: 3042: 3041: 3039: 3038: 3033: 3028: 3023: 3021:Dibenzopyrenes 3018: 3013: 3008: 3002: 3000: 2996: 2995: 2993: 2992: 2990:Tetraphenylene 2987: 2982: 2977: 2972: 2967: 2962: 2957: 2952: 2947: 2942: 2937: 2936: 2935: 2926: 2921: 2911: 2905: 2903: 2899: 2898: 2896: 2895: 2890: 2885: 2880: 2875: 2870: 2865: 2860: 2855: 2850: 2848:Benzanthracene 2844: 2842: 2838: 2837: 2835: 2834: 2829: 2824: 2819: 2814: 2812:Acenaphthylene 2809: 2803: 2801: 2797: 2796: 2794: 2793: 2788: 2783: 2777: 2775: 2771: 2770: 2763: 2762: 2755: 2748: 2740: 2731: 2730: 2728: 2727: 2722: 2717: 2712: 2706: 2704: 2700: 2699: 2696: 2695: 2693: 2692: 2684: 2679: 2674: 2668: 2666: 2662: 2661: 2659: 2658: 2656:4-Vinyltoluene 2653: 2651:Divinylbenzene 2648: 2642: 2640: 2636: 2635: 2632: 2631: 2629: 2628: 2623: 2618: 2616:2-Phenylhexane 2613: 2607: 2605: 2601: 2600: 2597: 2596: 2594: 2593: 2588: 2580: 2572: 2563: 2561: 2557: 2556: 2554: 2553: 2548: 2543: 2537: 2535: 2529: 2528: 2526: 2525: 2517: 2509: 2500: 2498: 2489: 2483: 2482: 2479: 2478: 2476: 2475: 2473:4-Ethyltoluene 2470: 2468:-Propylbenzene 2462: 2456: 2454: 2450: 2449: 2447: 2446: 2441: 2436: 2430: 2428: 2419: 2413: 2412: 2409: 2408: 2406: 2405: 2399: 2397: 2393: 2392: 2390: 2389: 2381: 2373: 2364: 2362: 2353: 2344: 2343: 2337: 2335: 2329: 2328: 2325: 2324: 2322: 2321: 2316: 2311: 2306: 2301: 2296: 2291: 2286: 2281: 2276: 2270: 2268: 2264: 2263: 2261: 2260: 2255: 2250: 2245: 2240: 2235: 2229: 2227: 2218: 2209: 2201: 2200: 2197: 2196: 2194: 2193: 2188: 2183: 2178: 2173: 2168: 2162: 2160: 2156: 2155: 2153: 2152: 2147: 2142: 2137: 2132: 2127: 2122: 2117: 2111: 2109: 2103: 2102: 2100: 2099: 2094: 2089: 2084: 2079: 2074: 2069: 2064: 2058: 2056: 2050: 2049: 2047: 2046: 2040: 2038: 2036:Bicycloalkenes 2032: 2031: 2029: 2028: 2026: 2021: 2016: 2011: 2006: 2000: 1998: 1992: 1991: 1989: 1988: 1983: 1978: 1973: 1968: 1963: 1958: 1953: 1947: 1945: 1939: 1938: 1935: 1934: 1932: 1931: 1926: 1921: 1916: 1911: 1906: 1900: 1898: 1894: 1893: 1891: 1890: 1885: 1880: 1875: 1870: 1865: 1860: 1855: 1850: 1844: 1842: 1841:Linear alkynes 1835: 1828: 1822: 1814: 1813: 1810: 1809: 1807: 1806: 1801: 1796: 1791: 1786: 1781: 1776: 1770: 1768: 1764: 1763: 1761: 1760: 1755: 1750: 1745: 1740: 1735: 1730: 1725: 1720: 1714: 1712: 1711:Linear alkenes 1705: 1699: 1693: 1682: 1672: 1671: 1668: 1667: 1665: 1664: 1658: 1656: 1652: 1651: 1649: 1648: 1643: 1638: 1633: 1628: 1623: 1618: 1613: 1608: 1603: 1598: 1592: 1590: 1584: 1583: 1581: 1580: 1574: 1568: 1561: 1559: 1557:Bicycloalkanes 1553: 1552: 1550: 1549: 1547: 1542: 1537: 1532: 1527: 1521: 1519: 1513: 1512: 1510: 1509: 1504: 1499: 1494: 1489: 1484: 1479: 1474: 1468: 1466: 1460: 1459: 1456: 1455: 1453: 1452: 1447: 1442: 1437: 1432: 1427: 1422: 1417: 1412: 1406: 1404: 1400: 1399: 1397: 1396: 1391: 1386: 1381: 1376: 1371: 1366: 1361: 1356: 1351: 1345: 1343: 1342:Linear alkanes 1336: 1329: 1323: 1312: 1304: 1303: 1296: 1295: 1288: 1281: 1273: 1267: 1266: 1258: 1257:External links 1255: 1252: 1251: 1218:Phytochemistry 1208: 1197: 1190: 1164: 1148: 1132: 1116: 1100: 1084: 1073:www.aatbio.com 1060: 1051:"Phenanthrene" 1042: 1010: 1001: 969: 968: 966: 963: 962: 961: 959:Phenanthroline 956: 951: 944: 941: 939:(liverworts). 909:Main article: 906: 903: 895: 892: 881:ring-expansion 845: 820: 819: 803: 800: 783: 780: 779: 778: 772: 763: 754: 741: 727: 724: 684: 681: 677:phenanthroline 652: 648: 636: 633: 632: 627: 605: 604: 600:standard state 597: 594: 593: 587: 582: 579: 578: 575: 572: 567: 564: 563: 559: 558: 555: 549: 548: 538: 531: 524: 509: 508: 507: 506: 504: 495: 494: 490: 489: 486: 480: 477: 476: 473: 468: 465: 464: 461: 455: 454: 451: 445: 444: 441: 435: 434: 431: 427: 426: 420: 414: 413: 410: 404: 399: 394: 391: 390: 386: 385: 383: 382: 379: 371: 370: 369: 366: 365: 363: 362: 358: 355: 354: 352: 348: 345: 344: 336: 335: 334: 331: 330: 328: 327: 314: 312: 300: 297: 296: 294: 293: 285: 283: 277: 276: 274: 273: 265: 263: 255: 252: 251: 244: 238: 237: 235: 234: 226: 224: 218: 217: 214: 209: 206: 205: 203: 202: 198: 196: 188: 187: 177: 169: 168: 166: 165: 157: 155: 149: 148: 146: 145: 137: 135: 129: 128: 125: 120: 117: 116: 114: 113: 105: 103: 96: 93: 92: 90: 89: 81: 79: 74: 71: 70: 66: 65: 61: 60: 54: 53: 49: 48: 40: 39: 31: 30: 15: 9: 6: 4: 3: 2: 6500: 6489: 6486: 6484: 6483:Phenanthrenes 6481: 6480: 6478: 6455: 6452: 6450: 6447: 6445: 6442: 6440: 6437: 6435: 6432: 6430: 6427: 6425: 6422: 6420: 6417: 6415: 6412: 6410: 6407: 6405: 6402: 6400: 6397: 6395: 6392: 6390: 6387: 6385: 6382: 6380: 6377: 6375: 6374:Herz reaction 6372: 6370: 6367: 6365: 6362: 6360: 6357: 6355: 6352: 6350: 6347: 6345: 6342: 6340: 6337: 6335: 6332: 6330: 6327: 6325: 6322: 6320: 6317: 6315: 6312: 6310: 6307: 6305: 6302: 6300: 6297: 6295: 6292: 6290: 6287: 6285: 6282: 6280: 6277: 6275: 6272: 6270: 6267: 6265: 6262: 6260: 6257: 6255: 6252: 6251: 6249: 6245: 6239: 6236: 6234: 6231: 6229: 6226: 6224: 6221: 6219: 6216: 6214: 6211: 6209: 6206: 6204: 6201: 6199: 6196: 6194: 6191: 6189: 6186: 6184: 6181: 6179: 6176: 6174: 6171: 6169: 6166: 6164: 6161: 6159: 6156: 6154: 6151: 6149: 6146: 6144: 6141: 6139: 6136: 6134: 6131: 6129: 6126: 6124: 6121: 6119: 6116: 6114: 6111: 6109: 6106: 6104: 6101: 6099: 6096: 6094: 6091: 6089: 6086: 6084: 6081: 6080: 6078: 6076: 6075:Cycloaddition 6072: 6066: 6063: 6061: 6058: 6056: 6053: 6051: 6048: 6046: 6043: 6041: 6038: 6036: 6033: 6031: 6028: 6026: 6023: 6021: 6018: 6016: 6013: 6011: 6008: 6006: 6003: 6001: 5998: 5996: 5993: 5991: 5988: 5986: 5983: 5981: 5978: 5976: 5973: 5971: 5968: 5966: 5963: 5961: 5958: 5956: 5953: 5951: 5948: 5946: 5943: 5941: 5938: 5936: 5933: 5931: 5928: 5926: 5923: 5921: 5920:Isay reaction 5918: 5916: 5913: 5911: 5908: 5906: 5903: 5901: 5898: 5896: 5893: 5891: 5888: 5886: 5883: 5881: 5878: 5876: 5873: 5871: 5868: 5866: 5863: 5861: 5858: 5856: 5853: 5851: 5848: 5846: 5843: 5841: 5838: 5836: 5833: 5831: 5828: 5826: 5823: 5821: 5818: 5816: 5815:Cycloaddition 5813: 5811: 5808: 5806: 5803: 5801: 5798: 5796: 5793: 5791: 5788: 5786: 5783: 5781: 5778: 5776: 5773: 5771: 5768: 5766: 5763: 5761: 5758: 5756: 5753: 5751: 5748: 5746: 5743: 5741: 5738: 5736: 5733: 5731: 5728: 5726: 5723: 5721: 5718: 5717: 5715: 5713: 5710:Ring forming 5707: 5701: 5698: 5696: 5693: 5691: 5688: 5686: 5683: 5681: 5678: 5676: 5673: 5671: 5668: 5666: 5663: 5661: 5658: 5656: 5653: 5651: 5648: 5646: 5643: 5641: 5638: 5636: 5633: 5631: 5628: 5626: 5623: 5621: 5618: 5616: 5613: 5611: 5610:Rupe reaction 5608: 5606: 5603: 5601: 5598: 5596: 5593: 5591: 5588: 5586: 5583: 5581: 5578: 5576: 5573: 5571: 5568: 5566: 5563: 5561: 5558: 5556: 5553: 5551: 5548: 5546: 5543: 5541: 5538: 5536: 5533: 5531: 5528: 5526: 5523: 5521: 5518: 5516: 5513: 5511: 5508: 5506: 5503: 5501: 5498: 5496: 5493: 5491: 5488: 5486: 5483: 5481: 5478: 5476: 5473: 5471: 5468: 5466: 5463: 5461: 5458: 5456: 5453: 5451: 5448: 5446: 5443: 5441: 5438: 5436: 5433: 5431: 5428: 5426: 5423: 5421: 5418: 5416: 5413: 5411: 5408: 5406: 5403: 5401: 5398: 5396: 5393: 5391: 5388: 5386: 5383: 5381: 5378: 5376: 5373: 5371: 5368: 5366: 5363: 5361: 5358: 5356: 5353: 5351: 5348: 5346: 5343: 5341: 5338: 5336: 5333: 5331: 5328: 5326: 5323: 5321: 5318: 5316: 5313: 5311: 5308: 5306: 5303: 5301: 5298: 5296: 5293: 5291: 5288: 5286: 5283: 5281: 5278: 5276: 5273: 5271: 5268: 5266: 5263: 5261: 5258: 5256: 5253: 5251: 5248: 5246: 5243: 5241: 5238: 5236: 5233: 5232: 5230: 5228: 5222: 5216: 5213: 5211: 5208: 5206: 5203: 5201: 5198: 5196: 5193: 5191: 5188: 5186: 5183: 5181: 5178: 5176: 5173: 5171: 5168: 5166: 5163: 5161: 5158: 5156: 5153: 5151: 5148: 5146: 5143: 5141: 5138: 5136: 5133: 5131: 5128: 5126: 5123: 5121: 5118: 5116: 5113: 5111: 5108: 5106: 5103: 5101: 5098: 5096: 5093: 5091: 5088: 5086: 5083: 5081: 5078: 5076: 5073: 5071: 5068: 5066: 5063: 5061: 5058: 5056: 5053: 5051: 5048: 5046: 5043: 5041: 5038: 5036: 5033: 5031: 5028: 5026: 5023: 5021: 5018: 5016: 5013: 5011: 5008: 5006: 5003: 5001: 5000:Ley oxidation 4998: 4996: 4993: 4991: 4988: 4986: 4983: 4981: 4978: 4976: 4973: 4971: 4968: 4966: 4965:Hydroxylation 4963: 4961: 4958: 4956: 4955:Hydrogenation 4953: 4951: 4948: 4946: 4943: 4941: 4938: 4936: 4933: 4931: 4928: 4926: 4923: 4921: 4918: 4916: 4913: 4911: 4908: 4906: 4903: 4901: 4898: 4896: 4893: 4891: 4890:DNA oxidation 4888: 4886: 4883: 4881: 4880:Deoxygenation 4878: 4876: 4873: 4871: 4868: 4866: 4863: 4861: 4858: 4856: 4853: 4851: 4848: 4846: 4843: 4841: 4838: 4836: 4833: 4831: 4828: 4826: 4823: 4821: 4818: 4816: 4813: 4811: 4808: 4806: 4803: 4801: 4798: 4796: 4793: 4791: 4788: 4786: 4783: 4781: 4778: 4776: 4773: 4771: 4770:Aromatization 4768: 4766: 4763: 4761: 4758: 4756: 4753: 4751: 4748: 4746: 4743: 4741: 4738: 4736: 4733: 4731: 4728: 4727: 4725: 4723: 4717: 4711: 4708: 4706: 4703: 4701: 4698: 4696: 4693: 4691: 4688: 4686: 4683: 4681: 4678: 4676: 4673: 4671: 4668: 4666: 4663: 4661: 4658: 4656: 4653: 4651: 4648: 4646: 4643: 4642: 4640: 4634: 4628: 4625: 4623: 4620: 4618: 4615: 4613: 4610: 4608: 4607:Reed reaction 4605: 4603: 4600: 4598: 4595: 4593: 4590: 4588: 4585: 4583: 4580: 4578: 4575: 4573: 4570: 4568: 4565: 4563: 4560: 4558: 4555: 4553: 4550: 4548: 4545: 4543: 4540: 4538: 4535: 4533: 4530: 4528: 4525: 4524: 4522: 4518:bond forming 4514: 4504: 4501: 4499: 4496: 4494: 4491: 4489: 4486: 4484: 4481: 4479: 4476: 4474: 4471: 4469: 4466: 4464: 4461: 4459: 4456: 4454: 4451: 4449: 4446: 4444: 4441: 4439: 4436: 4434: 4431: 4429: 4426: 4424: 4423:Cope reaction 4421: 4419: 4416: 4414: 4411: 4409: 4406: 4404: 4401: 4400: 4398: 4394: 4388: 4385: 4383: 4380: 4378: 4375: 4373: 4370: 4368: 4365: 4363: 4360: 4358: 4355: 4354: 4352: 4350: 4346: 4340: 4337: 4335: 4332: 4330: 4327: 4325: 4322: 4320: 4317: 4315: 4312: 4310: 4307: 4305: 4302: 4300: 4297: 4295: 4292: 4290: 4287: 4285: 4282: 4280: 4277: 4275: 4272: 4270: 4267: 4265: 4262: 4260: 4257: 4255: 4252: 4250: 4247: 4245: 4242: 4240: 4237: 4235: 4232: 4230: 4227: 4225: 4222: 4220: 4217: 4215: 4212: 4210: 4207: 4205: 4202: 4200: 4197: 4195: 4192: 4190: 4187: 4185: 4182: 4180: 4177: 4175: 4172: 4170: 4167: 4165: 4162: 4160: 4157: 4155: 4152: 4150: 4147: 4145: 4142: 4140: 4137: 4135: 4134:Nef synthesis 4132: 4130: 4127: 4125: 4122: 4120: 4117: 4115: 4112: 4110: 4109:Methylenation 4107: 4105: 4102: 4100: 4097: 4095: 4092: 4090: 4087: 4085: 4082: 4080: 4077: 4075: 4072: 4070: 4067: 4065: 4062: 4060: 4057: 4055: 4052: 4050: 4047: 4045: 4042: 4040: 4037: 4035: 4032: 4030: 4027: 4025: 4022: 4020: 4017: 4015: 4012: 4010: 4007: 4005: 4002: 4000: 3997: 3995: 3992: 3990: 3987: 3985: 3982: 3980: 3979:Heck reaction 3977: 3975: 3972: 3970: 3967: 3965: 3962: 3960: 3957: 3955: 3952: 3950: 3947: 3945: 3942: 3940: 3937: 3935: 3932: 3930: 3927: 3925: 3922: 3920: 3917: 3915: 3912: 3910: 3907: 3905: 3902: 3900: 3897: 3895: 3892: 3890: 3887: 3885: 3882: 3880: 3877: 3875: 3872: 3870: 3867: 3865: 3862: 3860: 3857: 3855: 3852: 3850: 3847: 3845: 3842: 3840: 3837: 3835: 3832: 3830: 3827: 3825: 3822: 3820: 3817: 3815: 3812: 3810: 3807: 3805: 3802: 3800: 3797: 3795: 3792: 3790: 3787: 3785: 3782: 3780: 3777: 3775: 3772: 3770: 3767: 3765: 3762: 3760: 3757: 3755: 3752: 3750: 3747: 3745: 3742: 3740: 3737: 3735: 3732: 3730: 3727: 3725: 3722: 3720: 3717: 3715: 3712: 3710: 3707: 3705: 3702: 3700: 3697: 3695: 3692: 3690: 3687: 3685: 3682: 3680: 3677: 3675: 3672: 3670: 3667: 3666: 3664: 3660:bond forming 3656: 3652: 3647: 3641: 3638: 3636: 3633: 3631: 3628: 3626: 3625:Y-aromaticity 3623: 3621: 3618: 3616: 3613: 3611: 3610:Walsh diagram 3608: 3606: 3603: 3601: 3598: 3596: 3595:Taft equation 3593: 3591: 3588: 3586: 3583: 3581: 3578: 3576: 3573: 3571: 3568: 3566: 3565:ÎŁ-aromaticity 3563: 3561: 3558: 3556: 3553: 3551: 3548: 3546: 3543: 3541: 3538: 3536: 3533: 3531: 3528: 3526: 3523: 3521: 3518: 3516: 3513: 3511: 3508: 3506: 3503: 3501: 3498: 3496: 3493: 3491: 3490:Marcus theory 3488: 3486: 3483: 3481: 3478: 3476: 3473: 3471: 3468: 3466: 3465:HĂŒckel's rule 3463: 3461: 3458: 3456: 3453: 3451: 3448: 3446: 3443: 3441: 3438: 3436: 3433: 3431: 3428: 3426: 3423: 3421: 3420:Evelyn effect 3418: 3416: 3413: 3411: 3408: 3406: 3403: 3401: 3400:Electron-rich 3398: 3396: 3393: 3391: 3388: 3386: 3383: 3381: 3378: 3376: 3373: 3371: 3368: 3366: 3363: 3361: 3358: 3356: 3353: 3351: 3348: 3346: 3343: 3341: 3338: 3336: 3333: 3331: 3328: 3326: 3323: 3321: 3318: 3316: 3315:Bema Hapothle 3313: 3311: 3308: 3306: 3303: 3301: 3298: 3296: 3293: 3291: 3288: 3286: 3283: 3281: 3278: 3276: 3273: 3271: 3268: 3266: 3263: 3262: 3259: 3253: 3250: 3248: 3245: 3243: 3240: 3238: 3235: 3233: 3230: 3228: 3225: 3223: 3220: 3218: 3215: 3213: 3210: 3208: 3205: 3204: 3201: 3197: 3189: 3184: 3182: 3177: 3175: 3170: 3169: 3166: 3154: 3151: 3149: 3146: 3144: 3141: 3139: 3136: 3134: 3131: 3130: 3128: 3124: 3118: 3115: 3113: 3110: 3108: 3105: 3103: 3100: 3098: 3095: 3093: 3090: 3088: 3085: 3083: 3080: 3077: 3073: 3070: 3068: 3065: 3063: 3060: 3058: 3055: 3053: 3050: 3049: 3047: 3043: 3037: 3034: 3032: 3029: 3027: 3024: 3022: 3019: 3017: 3014: 3012: 3011:Benzoperylene 3009: 3007: 3004: 3003: 3001: 2997: 2991: 2988: 2986: 2983: 2981: 2978: 2976: 2973: 2971: 2968: 2966: 2963: 2961: 2958: 2956: 2953: 2951: 2948: 2946: 2943: 2941: 2938: 2934: 2932: 2927: 2925: 2922: 2920: 2917: 2916: 2915: 2912: 2910: 2907: 2906: 2904: 2900: 2894: 2891: 2889: 2886: 2884: 2881: 2879: 2876: 2874: 2871: 2869: 2866: 2864: 2861: 2859: 2858:Benzofluorene 2856: 2854: 2853:Benzofluorene 2851: 2849: 2846: 2845: 2843: 2839: 2833: 2830: 2828: 2825: 2823: 2820: 2818: 2815: 2813: 2810: 2808: 2805: 2804: 2802: 2798: 2792: 2789: 2787: 2784: 2782: 2779: 2778: 2776: 2772: 2768: 2761: 2756: 2754: 2749: 2747: 2742: 2741: 2738: 2726: 2723: 2721: 2718: 2716: 2713: 2711: 2708: 2707: 2705: 2701: 2691: 2689: 2685: 2683: 2680: 2678: 2675: 2673: 2670: 2669: 2667: 2663: 2657: 2654: 2652: 2649: 2647: 2644: 2643: 2641: 2639:Vinylbenzenes 2637: 2627: 2624: 2622: 2619: 2617: 2614: 2612: 2609: 2608: 2606: 2602: 2592: 2589: 2587: 2586:-Butylbenzene 2585: 2581: 2579: 2578:-Butylbenzene 2577: 2573: 2571: 2570:-Butylbenzene 2569: 2565: 2564: 2562: 2558: 2552: 2549: 2547: 2544: 2542: 2539: 2538: 2536: 2534: 2530: 2524: 2522: 2518: 2516: 2514: 2510: 2508: 2506: 2502: 2501: 2499: 2497: 2493: 2490: 2488: 2484: 2474: 2471: 2469: 2467: 2463: 2461: 2458: 2457: 2455: 2451: 2445: 2442: 2440: 2437: 2435: 2432: 2431: 2429: 2427: 2423: 2420: 2418: 2414: 2404: 2401: 2400: 2398: 2394: 2388: 2386: 2382: 2380: 2378: 2374: 2372: 2370: 2366: 2365: 2363: 2361: 2357: 2354: 2352: 2348: 2342: 2339: 2338: 2336: 2334: 2333:Alkylbenzenes 2330: 2320: 2317: 2315: 2312: 2310: 2307: 2305: 2302: 2300: 2297: 2295: 2292: 2290: 2287: 2285: 2282: 2280: 2277: 2275: 2272: 2271: 2269: 2265: 2259: 2256: 2254: 2251: 2249: 2246: 2244: 2241: 2239: 2236: 2234: 2231: 2230: 2228: 2226: 2222: 2219: 2217: 2213: 2210: 2208: 2202: 2192: 2189: 2187: 2184: 2182: 2179: 2177: 2174: 2172: 2169: 2167: 2164: 2163: 2161: 2157: 2151: 2148: 2146: 2143: 2141: 2138: 2136: 2133: 2131: 2128: 2126: 2123: 2121: 2118: 2116: 2113: 2112: 2110: 2108: 2104: 2098: 2095: 2093: 2090: 2088: 2085: 2083: 2080: 2078: 2075: 2073: 2070: 2068: 2065: 2063: 2060: 2059: 2057: 2055: 2051: 2045: 2042: 2041: 2039: 2037: 2033: 2027: 2025: 2022: 2020: 2017: 2015: 2012: 2010: 2007: 2005: 2002: 2001: 1999: 1997: 1993: 1987: 1984: 1982: 1979: 1977: 1974: 1972: 1969: 1967: 1964: 1962: 1959: 1957: 1954: 1952: 1949: 1948: 1946: 1944: 1940: 1930: 1927: 1925: 1922: 1920: 1917: 1915: 1912: 1910: 1907: 1905: 1902: 1901: 1899: 1895: 1889: 1886: 1884: 1881: 1879: 1876: 1874: 1871: 1869: 1866: 1864: 1861: 1859: 1856: 1854: 1851: 1849: 1846: 1845: 1843: 1839: 1836: 1832: 1825: 1819: 1815: 1805: 1802: 1800: 1797: 1795: 1792: 1790: 1787: 1785: 1782: 1780: 1777: 1775: 1772: 1771: 1769: 1765: 1759: 1756: 1754: 1751: 1749: 1746: 1744: 1741: 1739: 1736: 1734: 1731: 1729: 1726: 1724: 1721: 1719: 1716: 1715: 1713: 1709: 1706: 1703: 1696: 1690: 1686: 1683: 1677: 1673: 1663: 1660: 1659: 1657: 1653: 1647: 1644: 1642: 1639: 1637: 1634: 1632: 1629: 1627: 1626:Dodecahedrane 1624: 1622: 1619: 1617: 1614: 1612: 1609: 1607: 1604: 1602: 1599: 1597: 1594: 1593: 1591: 1589: 1585: 1578: 1575: 1572: 1569: 1566: 1563: 1562: 1560: 1558: 1554: 1548: 1546: 1543: 1541: 1538: 1536: 1533: 1531: 1528: 1526: 1523: 1522: 1520: 1518: 1514: 1508: 1505: 1503: 1500: 1498: 1495: 1493: 1490: 1488: 1485: 1483: 1480: 1478: 1475: 1473: 1470: 1469: 1467: 1465: 1461: 1451: 1448: 1446: 1443: 1441: 1438: 1436: 1433: 1431: 1428: 1426: 1423: 1421: 1418: 1416: 1413: 1411: 1408: 1407: 1405: 1401: 1395: 1392: 1390: 1387: 1385: 1382: 1380: 1377: 1375: 1372: 1370: 1367: 1365: 1362: 1360: 1357: 1355: 1352: 1350: 1347: 1346: 1344: 1340: 1337: 1333: 1326: 1320: 1316: 1313: 1305: 1301: 1294: 1289: 1287: 1282: 1280: 1275: 1274: 1271: 1264: 1261: 1260: 1247: 1243: 1239: 1235: 1231: 1227: 1223: 1219: 1212: 1206: 1201: 1193: 1191:9780470638859 1187: 1183: 1179: 1175: 1168: 1161: 1157: 1152: 1145: 1141: 1136: 1129: 1125: 1120: 1113: 1109: 1104: 1097: 1093: 1088: 1074: 1070: 1064: 1056: 1055:Sigma-Alrdich 1052: 1046: 1030: 1023: 1017: 1015: 1005: 999: 995: 991: 990: 983: 981: 979: 977: 975: 970: 960: 957: 955: 952: 950: 947: 946: 940: 938: 934: 930: 926: 925:Dioscoreaceae 922: 918: 912: 911:Phenanthrenes 902: 900: 888: 884: 882: 878: 874: 866: 862: 860: 856: 855:diarylethenes 851: 849: 841: 837: 833: 829: 825: 817: 813: 812: 811: 809: 799: 797: 793: 789: 776: 773: 771: 770:sulfuric acid 767: 764: 762: 758: 755: 753: 749: 745: 742: 740: 736: 733: 732: 731: 723: 721: 720:scintillators 717: 712: 710: 706: 702: 698: 694: 690: 680: 678: 674: 670: 665: 661: 658: 646: 642: 630: 623: 618: 601: 595: 592: 588: 585: 584:Dipole moment 581: 580: 573: 570: 566: 565: 560: 556: 554: 551: 550: 543: 536: 529: 505: 502: 501: 497: 496: 491: 487: 483: 479: 478: 474: 471: 467: 466: 462: 460: 459:Boiling point 457: 456: 452: 450: 449:Melting point 447: 446: 442: 440: 437: 436: 432: 429: 428: 421: 419: 416: 415: 400: 397: 393: 392: 387: 378: 377: 374: 367: 353: 343: 342: 339: 332: 324: 320: 319:DTXSID6024254 316: 315: 313: 303: 299: 298: 291: 287: 286: 284: 282: 279: 278: 271: 267: 266: 264: 258: 254: 253: 249: 245: 243: 240: 239: 232: 228: 227: 225: 223: 220: 219: 215: 212: 208: 207: 200: 199: 197: 195: 190: 189: 185: 181: 178: 176: 174:ECHA InfoCard 171: 170: 163: 159: 158: 156: 154: 151: 150: 143: 139: 138: 136: 134: 131: 130: 126: 123: 119: 118: 111: 107: 106: 104: 100: 95: 94: 87: 83: 82: 80: 77: 73: 72: 67: 59: 55: 50: 46: 41: 37: 32: 28: 23: 20:Phenanthrene 5415:Ene reaction 4775:Autoxidation 4636:Degradation 4527:Azo coupling 4304:Ugi reaction 3904:Ene reaction 3704:Alkynylation 3555:Polyfluorene 3550:Polar effect 3415:Electrophile 3330:Bredt's rule 3300:Baird's rule 3270:Alpha effect 3057:Dicoronylene 3006:Anthanthrene 2930: 2888:Triphenylene 2873:Fluoranthene 2832:Phenanthrene 2831: 2807:Acenaphthene 2687: 2583: 2575: 2567: 2520: 2512: 2504: 2465: 2439:Pseudocumene 2403:Ethylbenzene 2384: 2376: 2368: 2299:Phenanthrene 2298: 2207:hydrocarbons 2082:Cycloheptyne 2072:Cyclopentyne 2062:Cyclopropyne 2054:Cycloalkynes 1971:Cycloheptene 1961:Cyclopentene 1951:Cyclopropene 1943:Cycloalkenes 1830: 1823: 1701: 1694: 1681:hydrocarbons 1662:Spiroalkanes 1492:Cycloheptane 1482:Cyclopentane 1472:Cyclopropane 1464:Cycloalkanes 1331: 1324: 1311:hydrocarbons 1300:Hydrocarbons 1263:Phenanthrene 1221: 1217: 1211: 1200: 1173: 1167: 1151: 1135: 1119: 1103: 1087: 1076:. Retrieved 1072: 1063: 1054: 1045: 1033:. Retrieved 1028: 1004: 988: 929:Combretaceae 914: 897: 870: 852: 830:group using 828:cyclohexanol 821: 807: 805: 785: 752:raney nickel 739:chromic acid 729: 713: 686: 666: 662: 641:Phenanthrene 640: 639: 499: 69:Identifiers 62:Phenanthrene 3914:Ethenolysis 3560:Ring strain 3530:Nucleophile 3355:Clar's rule 3295:Aromaticity 3031:Triangulene 3016:Corannulene 2924:Benzopyrene 2919:Benzopyrene 2914:Benzopyrene 2791:Naphthalene 2487:C4-Benzenes 2444:Hemellitene 2417:C3-Benzenes 2351:C2-Benzenes 2314:Corannulene 2233:Naphthalene 2097:Cyclodecyne 2092:Cyclononyne 2087:Cyclooctyne 2077:Cyclohexyne 2067:Cyclobutyne 1986:Cyclodecene 1981:Cyclononene 1976:Cyclooctene 1966:Cyclohexene 1956:Cyclobutene 1676:Unsaturated 1507:Cyclodecane 1502:Cyclononane 1497:Cyclooctane 1487:Cyclohexane 1477:Cyclobutane 1160:p. 489 1144:p. 482 1128:p. 134 1112:p. 313 1096:p. 757 921:Orchidaceae 792:Clar's rule 716:Stoke shift 705:acetic acid 569:Point group 553:Flash point 430:Appearance 389:Properties 180:100.001.437 142:CHEBI:28851 6477:Categories 6198:Ozonolysis 5725:Annulation 5075:Ozonolysis 3194:Topics in 3076:Hexa-cata- 2817:Anthracene 2546:Prehnitene 2434:Mesitylene 2289:Circulenes 2238:Anthracene 2166:Alkatriene 2135:Heptadiene 2125:Pentadiene 2115:Propadiene 2044:Norbornene 1914:Isoheptyne 1904:Isopentyne 1789:Isoheptene 1779:Isopentene 1601:Diamondoid 1596:Adamantane 1571:Norbornane 1435:Isoheptane 1425:Neopentane 1415:Isopentane 1078:2024-07-30 965:References 954:Anthracene 933:Betulaceae 788:anthracene 775:Ozonolysis 701:chloroform 669:phenacenes 562:Structure 475:1.6 mg/L 443:1.18 g/cm 418:Molar mass 290:448J8E5BST 153:ChemSpider 97:3D model ( 76:CAS Number 5712:reactions 5227:reactions 4722:reactions 4638:reactions 4520:reactions 3662:reactions 3153:Phenacene 3143:Cyclacene 3138:Circulene 3067:Heptacene 2975:Pentacene 2883:Tetracene 2827:Phenalene 2715:Annulynes 2710:Annulenes 2551:Isodurene 2284:Helicenes 2258:Heptacene 2248:Pentacene 2243:Tetracene 2171:Alkadiyne 2150:Decadiene 2145:Nonadiene 2140:Octadiene 2130:Hexadiene 2120:Butadiene 1929:Isodecyne 1924:Isononyne 1919:Isooctyne 1909:Isohexyne 1804:Isodecene 1799:Isononene 1794:Isooctene 1784:Isohexene 1774:Isobutene 1679:aliphatic 1636:Churchane 1631:Basketane 1450:Isodecane 1445:Isononane 1440:Isooctane 1430:Isohexane 1410:Isobutane 1309:aliphatic 1307:Saturated 905:In plants 802:Synthesis 726:Chemistry 201:266-028-2 193:EC Number 3605:Vinylogy 3275:Annulene 3222:Reagents 3148:Helicene 3102:Sumanene 3092:Rubicene 3082:Kekulene 3052:Coronene 3045:7+ rings 3036:Zethrene 3026:Hexacene 2980:Perylene 2868:Chrysene 2822:Fluorene 2781:Butalene 2319:Kekulene 2304:Chrysene 2294:Butalene 2279:Fluorene 2253:Hexacene 2205:Aromatic 2176:Cumulene 1646:Twistane 1641:Pagodane 1621:Prismane 1246:18243254 949:Chrysene 943:See also 899:Ravatite 875:and the 840:selenium 750:gas and 748:hydrogen 500:NFPA 704 493:Hazards 484:(χ) 127:1905428 3265:A value 3117:Truxene 3097:Rubrene 3087:Ovalene 2999:6 rings 2902:5 rings 2841:4 rings 2800:3 rings 2786:Azulene 2774:2 rings 2672:Benzene 2646:Styrene 2523:-Cymene 2515:-Cymene 2507:-Cymene 2496:Cymenes 2387:-Xylene 2379:-Xylene 2371:-Xylene 2360:Xylenes 2341:Toluene 2274:Azulene 1873:Heptyne 1863:Pentyne 1853:Propyne 1818:Alkynes 1743:Heptene 1733:Pentene 1723:Propene 1689:Alkenes 1611:Sterane 1577:Decalin 1565:Housane 1379:Heptane 1369:Pentane 1359:Propane 1349:Methane 1319:Alkanes 1226:Bibcode 1035:19 July 996:of the 992:in the 989:85-01-8 761:bromine 709:benzene 689:toluene 657:benzene 622:what is 620: ( 439:Density 423:178.234 257:PubChem 248:C031181 86:85-01-8 2985:Picene 2878:Pyrene 2541:Durene 2460:Cumene 2309:Pyrene 2225:Acenes 2107:Dienes 1888:Decyne 1883:Nonyne 1878:Octyne 1868:Hexyne 1858:Butyne 1848:Ethyne 1758:Decene 1753:Nonene 1748:Octene 1738:Hexene 1728:Butene 1718:Ethene 1616:Cubane 1394:Decane 1389:Nonane 1384:Octane 1374:Hexane 1364:Butane 1354:Ethane 1244:  1188:  879:-type 838:using 673:acenes 617:verify 614:  373:SMILES 231:C11422 216:28699 52:Names 3133:Acene 2703:Other 2688:trans 2665:Other 2604:Other 2560:Other 2453:Other 2396:Other 2267:Other 2191:Enyne 2159:Other 1655:Other 1025:(PDF) 697:ether 643:is a 338:InChI 133:ChEBI 99:JSmol 2584:tert 2216:PAHs 1242:PMID 1186:ISBN 1037:2019 931:and 806:The 707:and 281:UNII 242:MeSH 222:KEGG 2576:sec 1833:− 2 1334:+ 2 1234:doi 1178:doi 307:EPA 270:995 260:CID 162:970 6479:: 1240:. 1232:. 1222:69 1220:. 1184:. 1071:. 1053:. 1027:. 1013:^ 973:^ 927:, 861:): 850:. 848:Se 722:. 711:. 703:, 699:, 695:, 691:, 679:. 653:10 649:14 589:0 576:2v 411:10 405:14 3187:e 3180:t 3173:v 3078:) 3074:( 2931:H 2929:6 2759:e 2752:t 2745:v 2568:n 2521:p 2513:m 2505:o 2466:n 2385:p 2377:m 2369:o 1831:n 1829:2 1827:H 1824:n 1821:C 1702:n 1700:2 1698:H 1695:n 1692:C 1332:n 1330:2 1328:H 1325:n 1322:C 1292:e 1285:t 1278:v 1248:. 1236:: 1228:: 1194:. 1180:: 1081:. 1057:. 1039:. 857:( 846:2 844:H 651:H 612:N 591:D 574:C 541:0 534:1 527:1 408:H 402:C 309:) 305:( 101:)

Index


Ball-and-stick model of the phenanthrene molecule
Phenanthrene
Preferred IUPAC name
CAS Number
85-01-8
JSmol
Interactive image
Beilstein Reference
ChEBI
CHEBI:28851
ChemSpider
970
ECHA InfoCard
100.001.437
Edit this at Wikidata
EC Number
Gmelin Reference
KEGG
C11422
MeSH
C031181
PubChem
995
UNII
448J8E5BST
CompTox Dashboard
DTXSID6024254
Edit this at Wikidata
InChI

Text is available under the Creative Commons Attribution-ShareAlike License. Additional terms may apply.

↑