Knowledge

Anthraquinone

Source 📝

36: 375: 242: 577: 45: 27: 689: 975:. The lignin is degraded and becomes more watersoluble and thereby more easy to wash away from the pulp, while the anthraquinone is regenerated. This process gives an increase in yield of pulp, typically 1–3% and a reduction in 585: 987:
9,10-anthraquinone is used as a bird repellant on seeds, and as a gas generator in satellite balloons. It has also been mixed with lanolin and used as a wool spray to protect sheep flocks against
557: 2376: 4591: 999:
Several other isomers of anthraquinone exist, including the 1,2-, 1,4-, and 2,6-anthraquinones. They are of minor importance compared to 9,10-anthraquinone.
1307: 702: 3707: 3652: 1145: 1103: 4420: 3762: 3912: 2546: 4641: 1361:"A Novel Complex Locus UGT1 Encodes Human Bilirubin, Phenol, and other UDP-Glucuronosyltransferase Isozymes with Identical Carboxyl Termini" 4415: 2241: 414: 3517: 1438: 4087: 3287: 2031: 909:. Sulfonation with sulfuric acid gives anthroquinone-1-sulfonic acid, which reacts with sodium chlorate to give 1-chloroanthaquinone. 4252: 4182: 4162: 3657: 2824: 2286: 2705: 2261: 1474: 4007: 4485: 4435: 2839: 3942: 4581: 4390: 4047: 4027: 3987: 2794: 1737: 1127: 1074: 4576: 4506: 4405: 4062: 3917: 3547: 3392: 3002: 2629: 2406: 4656: 4440: 3752: 3242: 2917: 697: 3462: 4651: 4365: 4227: 4017: 3982: 1162: 809:
near room temperature but 2.25 g will dissolve in 100 g of boiling ethanol. It is found in nature as the rare mineral
4541: 4480: 4012: 3927: 3897: 3877: 3742: 3737: 3112: 3037: 2680: 2634: 2501: 1762: 1291: 1087: 389: 147: 4646: 4606: 4556: 4232: 4032: 3782: 3712: 2201: 1772: 3847: 2740: 2461: 709: 4400: 4242: 4112: 4107: 3922: 3397: 3307: 2897: 2829: 2720: 2296: 2051: 1976: 1431: 4157: 881:
to give a 1,3-diphenylbutene, which then can be transformed to the anthraquinone. This process was pioneered by
4686: 4571: 4470: 4410: 4057: 3852: 3812: 3787: 3697: 3157: 2191: 2121: 1757: 1687: 890: 538: 3277: 1311: 4676: 4262: 4152: 3772: 3497: 3282: 3227: 3072: 3032: 2864: 2619: 2336: 2186: 1333: 4636: 4197: 3642: 4671: 4586: 4561: 4536: 4521: 4445: 4360: 4257: 4217: 4082: 4037: 3802: 3347: 3332: 3197: 2987: 2655: 2411: 2091: 2066: 2036: 1627: 1282:
Sturgeoff, L. G.; Pitl, Y. (1997) . "Low Kappa Pulping without Capital Investment". In Goyal, G. C. (ed.).
613: 322: 237: 4621: 4566: 4511: 4222: 4142: 4042: 3757: 3722: 3567: 3457: 3172: 3167: 2992: 2952: 2849: 2660: 2624: 2476: 2466: 2321: 2181: 2041: 1991: 1986: 1961: 1921: 1867: 1632: 1622: 1597: 353: 576: 199: 4596: 4297: 4102: 3537: 3422: 3102: 3077: 3017: 2874: 2609: 2316: 2096: 2061: 1966: 1657: 1592: 1424: 1111: 623: 3887: 2151: 4696: 4601: 4455: 4335: 4307: 4277: 4192: 4122: 4077: 4052: 3972: 3872: 3832: 3527: 3147: 3137: 3062: 2586: 2446: 2441: 2421: 2106: 1903: 1882: 1842: 1767: 1359:
Ritter, J. K.; Chen, F.; Sheen, Y. Y.; Tran, H. M.; Kimura, S.; Yeatman, M. T.; Owens, I. S. (1992).
1587: 4661: 4551: 4531: 4395: 4237: 4147: 4117: 4097: 3992: 3947: 3777: 3687: 3617: 3502: 3492: 3322: 2879: 2819: 2784: 2591: 2571: 2531: 2306: 2176: 2141: 2101: 1852: 1692: 1682: 1612: 968: 956: 902: 370: 4127: 4735: 4631: 4490: 4340: 4282: 4207: 4187: 3907: 3857: 3717: 3682: 3622: 3552: 3107: 2854: 2834: 2566: 2486: 2381: 2341: 2311: 2246: 2131: 2116: 2026: 2016: 1677: 1602: 1557: 1411: 1406: 967:, and thereby protecting it from alkaline degradation (peeling). The anthraquinone is reduced to 837: 1892: 4370: 4092: 3842: 3822: 3797: 3747: 3662: 3637: 3592: 3562: 3542: 3512: 3477: 3432: 3407: 3382: 3267: 3192: 2972: 2665: 2601: 2401: 2126: 2046: 1732: 1707: 1484: 1479: 855:. o-Benzoylbenzoic acid is an intermediate. This reaction is useful for producing substituted 4706: 4292: 4247: 3962: 3932: 3902: 3837: 3817: 3732: 3727: 3692: 3647: 3632: 3627: 3607: 3597: 3532: 3522: 3452: 3402: 2922: 2725: 2301: 2256: 2086: 2076: 1822: 1747: 1542: 1504: 599: 569: 1752: 4475: 4425: 4375: 4355: 4345: 4202: 4177: 3892: 3882: 3767: 3582: 3577: 3507: 3292: 3092: 3052: 2982: 2947: 2902: 2869: 2735: 2710: 2690: 2511: 2471: 2431: 2396: 2326: 2081: 1951: 1926: 1464: 1045: 863: 733: 331: 57: 219: 8: 4681: 4666: 4312: 4287: 4272: 4267: 3997: 3952: 3937: 3827: 3807: 3702: 3587: 3572: 3417: 3362: 3352: 3317: 3082: 2957: 2932: 2844: 2700: 2685: 2670: 2491: 2436: 2206: 2056: 2001: 1872: 1787: 1647: 1572: 959:(SET). The anthraquinone oxidizes the reducing end of polysaccharides in the pulp, i.e., 631: 113: 4691: 3342: 2526: 1717: 374: 241: 179: 123: 35: 4430: 4380: 4350: 4212: 4002: 3792: 3677: 3612: 3602: 3367: 3297: 3262: 3257: 3237: 3232: 3177: 3087: 2937: 2799: 2789: 2695: 2481: 2426: 2356: 2276: 2171: 2071: 2006: 1931: 1777: 1642: 1577: 1562: 1008: 845: 790: 159: 1380: 4167: 3487: 3372: 3337: 3302: 3247: 3202: 3117: 3097: 3047: 3042: 3012: 2997: 2907: 2814: 2750: 2715: 2541: 2416: 2291: 2216: 2196: 2111: 1946: 1941: 1887: 1797: 1702: 1662: 1617: 1499: 1494: 1459: 1385: 1287: 1158: 1123: 1083: 1017:
In terms of metabolism of substituted anthraquinones, the enzyme encoded by the gene
3162: 4701: 4546: 4516: 4460: 4385: 4317: 4072: 4022: 3867: 3672: 3447: 3442: 3387: 3377: 3152: 2962: 2942: 2912: 2809: 2745: 2730: 2561: 2516: 2506: 2496: 2391: 2371: 2366: 2351: 2346: 2226: 2221: 2161: 2146: 2136: 1981: 1971: 1837: 1827: 1727: 1722: 1697: 1637: 1489: 1448: 1375: 1264: 1241: 1214: 1187: 1150: 1115: 736: 521: 437: 1817: 4611: 4302: 4137: 4132: 3427: 3412: 3357: 3312: 3272: 3222: 3187: 3182: 3127: 3122: 3057: 3007: 2927: 2755: 2639: 2614: 2576: 2551: 2536: 2521: 2456: 2331: 2281: 2271: 2251: 2211: 2021: 2011: 1996: 1792: 1712: 1582: 1552: 1537: 1532: 1360: 1108:
Nomenclature of Organic Chemistry: IUPAC Recommendations and Preferred Names 2013
1102: 941: 295: 250: 4616: 4526: 4465: 3557: 3467: 3437: 3212: 3067: 2804: 2581: 2451: 2266: 2236: 1936: 1832: 1607: 1469: 1035: 918: 867: 856: 786: 680: 1416: 4729: 4626: 4327: 4172: 4067: 3862: 3252: 3217: 3207: 3142: 3132: 3022: 2859: 2675: 2386: 2361: 2231: 1877: 1862: 1847: 1742: 1672: 1652: 1567: 1261:
A comprehensive mechanism for anthraquinone mass transfer in alkaline pulping
1245: 1218: 1205:
Scott, W. J.; Allen, C. F. H. (1938). "Potassium Anthraquinone-α-Sulfonate".
1191: 1154: 964: 937: 781:
groups are located on the central ring. It is used as a digester additive to
510: 500: 230: 1358: 821:
There are several current industrial methods to produce 9,10-anthraquinone:
627: 3667: 3027: 2779: 2556: 2156: 1956: 1807: 1802: 1667: 1522: 1030: 976: 945: 929: 830: 782: 1389: 1119: 1021:
has glucuronidase activity with many substrates including anthraquinones.
805:
but soluble in hot organic solvents. It is almost completely insoluble in
2166: 1812: 1782: 1547: 1407:
National Pollutant Inventory — Polycyclic Aromatic Hydrocarbon Fact Sheet
646: 4450: 3977: 3327: 826: 798: 671: 465: 210: 44: 1268: 398:
InChI=1S/C14H8O2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-8H
1079: 960: 871: 794: 619: 342: 26: 679:
Except where otherwise noted, data are given for materials in their
1857: 1527: 1040: 952: 928:
9,10-Anthraquinone is used as a digester additive in production of
906: 270: 789:
are generated by organisms or synthesised industrially for use as
639: 146: 1517: 878: 841: 810: 806: 666: 486: 282: 1232:
Scott, W. J.; Allen, C. F. H. (1938). "α-Chloroanthraquinone".
1018: 972: 933: 778: 770: 190: 797:. Anthraquinone is a yellow, highly crystalline solid, poorly 949: 849: 802: 774: 306: 170: 136: 358: 882: 773:
exist but these terms usually refer to 9,10-anthraquinone (
261: 988: 1178:
Macleod, L. C.; Allen, C. F. H. (1934). "Benzanthrone".
1263:(Thesis). Georgia Institute of Technology. p. 30. 16:
Yellow chemical compound: building block of many dyes
4592:
Erlenmeyer–Plöchl azlactone and amino-acid synthesis
923: 905:(anthrahydroquinone). Reduction with copper gives 3653:Divinylcyclopropane-cycloheptadiene rearrangement 1104:International Union of Pure and Applied Chemistry 889:It also arises via the Rickert–Alder reaction, a 4727: 1014:, probably because it is so insoluble in water. 294: 1446: 122: 3913:Thermal rearrangement of aromatic hydrocarbons 2547:Thermal rearrangement of aromatic hydrocarbons 1412:Molecules Spontaneously Form Honeycomb Network 1146:Ullmann's Encyclopedia of Industrial Chemistry 635: 605: 4642:Lectka enantioselective beta-lactam synthesis 1902: 1432: 1281: 4421:Inverse electron-demand Diels–Alder reaction 2242:Heterogeneous metal catalyzed cross-coupling 1177: 505:284.8 Â°C (544.6 Â°F; 558.0 K) 3763:Lobry de Bruyn–Van Ekenstein transformation 1352: 1439: 1425: 1231: 1204: 373: 240: 218: 4253:Petrenko-Kritschenko piperidone synthesis 3708:Fritsch–Buttenberg–Wiechell rearrangement 1379: 330: 4416:Intramolecular Diels–Alder cycloaddition 1331: 369: 4728: 4436:Metal-centered cycloaddition reactions 4088:Debus–Radziszewski imidazole synthesis 2032:Bodroux–Chichibabin aldehyde synthesis 1136: 874:followed by oxidative dehydrogenation. 651:185 Â°C (365 Â°F; 458 K) 515:377 Â°C (711 Â°F; 650 K) 231: 4582:Diazoalkane 1,3-dipolar cycloaddition 4486:Vinylcyclopropane (5+2) cycloaddition 4391:Diazoalkane 1,3-dipolar cycloaddition 4163:Hurd–Mori 1,2,3-thiadiazole synthesis 3658:Dowd–Beckwith ring-expansion reaction 2825:Hurd–Mori 1,2,3-thiadiazole synthesis 1901: 1738:LFER solvent coefficients (data page) 1420: 1142: 1075:CRC Handbook of Chemistry and Physics 1067: 1065: 1063: 1061: 955:. The reaction mechanism may involve 401:Key: RZVHIXYEVGDQDX-UHFFFAOYSA-N 198: 178: 3393:Sharpless asymmetric dihydroxylation 2630:Methoxymethylenetriphenylphosphorane 1258: 777:: 9,10-dioxoanthracene) wherein the 3518:Allen–Millar–Trippett rearrangement 1334:"How to solve a problem like a kea" 877:The acid-catalyzed dimerization of 285: 269: 13: 4657:Nitrone-olefin (3+2) cycloaddition 4652:Niementowski quinazoline synthesis 4441:Nitrone-olefin (3+2) cycloaddition 4366:Azide-alkyne Huisgen cycloaddition 4228:Niementowski quinazoline synthesis 3983:Azide-alkyne Huisgen cycloaddition 3288:Meerwein–Ponndorf–Verley reduction 2840:Leimgruber–Batcho indole synthesis 1058: 948:processes. The anthraquinone is a 14: 4747: 4481:Trimethylenemethane cycloaddition 4183:Johnson–Corey–Chaykovsky reaction 4048:Cadogan–Sundberg indole synthesis 4028:Bohlmann–Rahtz pyridine synthesis 3988:Baeyer–Emmerling indole synthesis 2795:Cadogan–Sundberg indole synthesis 2287:Johnson–Corey–Chaykovsky reaction 1400: 89:9,10-Dihydro-9,10-dioxoanthracene 4577:Cook–Heilbron thiazole synthesis 4406:Hexadehydro Diels–Alder reaction 4233:Niementowski quinoline synthesis 4063:Cook–Heilbron thiazole synthesis 4008:Bischler–Möhlau indole synthesis 3918:Tiffeneau–Demjanov rearrangement 3548:Baker–Venkataraman rearrangement 2706:Horner–Wadsworth–Emmons reaction 2377:Mizoroki-Heck vs. Reductive Heck 2262:Horner–Wadsworth–Emmons reaction 1773:Neighbouring group participation 1072:Haynes, William M., ed. (2016). 994: 924:Digester additive in papermaking 687: 575: 449: 43: 34: 25: 4113:Fiesselmann thiophene synthesis 3943:Westphalen–LettrĂ© rearrangement 3923:Vinylcyclopropane rearrangement 3753:Kornblum–DeLaMare rearrangement 3398:Epoxidation of allylic alcohols 3308:Noyori asymmetric hydrogenation 3243:Kornblum–DeLaMare rearrangement 2918:Gallagher–Hollander degradation 1368:Journal of Biological Chemistry 1325: 912: 683:(at 25 Â°C , 100 kPa). 4572:Chichibabin pyridine synthesis 4058:Chichibabin pyridine synthesis 4018:Blum–Ittah aziridine synthesis 3853:Ring expansion and contraction 2122:Cross dehydrogenative coupling 1332:Dudding, Adam (29 July 2012). 1300: 1275: 1252: 1225: 1198: 1171: 1112:The Royal Society of Chemistry 1096: 1007:Anthraquinone has no recorded 539:Occupational safety and health 455: 443: 1: 4542:Bischler–Napieralski reaction 4500:Heterocycle forming reactions 4153:Hemetsberger indole synthesis 4013:Bischler–Napieralski reaction 3928:Wagner–Meerwein rearrangement 3898:Sommelet–Hauser rearrangement 3878:Seyferth–Gilbert homologation 3743:Ireland–Claisen rearrangement 3738:Hofmann–Martius rearrangement 3498:2,3-sigmatropic rearrangement 3113:Corey–Winter olefin synthesis 3038:Barton–McCombie deoxygenation 2681:Corey–Winter olefin synthesis 2635:Seyferth–Gilbert homologation 2502:Seyferth–Gilbert homologation 1381:10.1016/S0021-9258(19)50724-4 1286:. TAPPI Press. pp. 3–9. 1051: 982: 4647:Lehmstedt–Tanasescu reaction 4607:Gabriel–Colman rearrangement 4562:Bucherer carbazole synthesis 4557:Borsche–Drechsel cyclization 4537:Bernthsen acridine synthesis 4522:Bamberger triazine synthesis 4507:Algar–Flynn–Oyamada reaction 4218:Nazarov cyclization reaction 4083:De Kimpe aziridine synthesis 4038:Bucherer carbazole synthesis 4033:Borsche–Drechsel cyclization 3803:Nazarov cyclization reaction 3783:Meyer–Schuster rearrangement 3713:Gabriel–Colman rearrangement 3463:Wolffenstein–Böters reaction 3348:Reduction of nitro compounds 3198:Grundmann aldehyde synthesis 3003:Algar–Flynn–Oyamada reaction 2412:Olefin conversion technology 2407:Nozaki–Hiyama–Kishi reaction 2202:Gabriel–Colman rearrangement 2092:Claisen-Schmidt condensation 2037:Bouveault aldehyde synthesis 896: 816: 7: 4622:Hantzsch pyridine synthesis 4401:Enone–alkene cycloadditions 4223:Nenitzescu indole synthesis 4143:Hantzsch pyridine synthesis 4108:Ferrario–Ackermann reaction 3758:Kowalski ester homologation 3723:Halogen dance rearrangement 3568:Benzilic acid rearrangement 2993:Akabori amino-acid reaction 2953:Von Braun amide degradation 2898:Barbier–Wieland degradation 2850:Nenitzescu indole synthesis 2830:Kharasch–Sosnovsky reaction 2721:Julia–Kocienski olefination 2625:Kowalski ester homologation 2322:Kowalski ester homologation 2297:Julia–Kocienski olefination 2052:Cadiot–Chodkiewicz coupling 1977:Aza-Baylis–Hillman reaction 1922:Acetoacetic ester synthesis 1633:Dynamic binding (chemistry) 1623:Conrotatory and disrotatory 1598:Charge remote fragmentation 1143:Vogel, A. "Anthraquinone". 1071: 1024: 10: 4752: 4687:Robinson–Gabriel synthesis 4637:Kröhnke pyridine synthesis 4471:Retro-Diels–Alder reaction 4411:Imine Diels–Alder reaction 4198:Kröhnke pyridine synthesis 3813:Newman–Kwart rearrangement 3788:Mislow–Evans rearrangement 3698:Fischer–Hepp rearrangement 3643:Di-π-methane rearrangement 3423:Stephen aldehyde synthesis 3158:Eschweiler–Clarke reaction 2875:Williamson ether synthesis 2192:Fujiwara–Moritani reaction 2097:Combes quinoline synthesis 2062:Carbonyl olefin metathesis 1763:More O'Ferrall–Jencks plot 1688:Grunwald–Winstein equation 1658:Electron-withdrawing group 1593:Catalytic resonance theory 1308:"www.americanheritage.com" 971:which then can react with 916: 891:retro-Diels–Alder reaction 422:O=C1c2ccccc2C(=O)c3ccccc13 4697:Urech hydantoin synthesis 4677:Pomeranz–Fritsch reaction 4602:Fischer oxazole synthesis 4499: 4336:1,3-Dipolar cycloaddition 4326: 4308:Urech hydantoin synthesis 4278:Reissert indole synthesis 4263:Pomeranz–Fritsch reaction 4193:Knorr quinoline synthesis 4123:Fischer oxazole synthesis 4053:Camps quinoline synthesis 3973:1,3-Dipolar cycloaddition 3961: 3873:Semipinacol rearrangement 3848:Ramberg–BĂ€cklund reaction 3833:Piancatelli rearrangement 3773:McFadyen–Stevens reaction 3528:Alpha-ketol rearrangement 3476: 3283:McFadyen–Stevens reaction 3228:Kiliani–Fischer synthesis 3148:Elbs persulfate oxidation 3073:Bouveault–Blanc reduction 3033:Baeyer–Villiger oxidation 2971: 2888: 2865:Schotten–Baumann reaction 2768: 2741:Ramberg–BĂ€cklund reaction 2648: 2620:Kiliani–Fischer synthesis 2600: 2462:Ramberg–BĂ€cklund reaction 2447:Pinacol coupling reaction 2442:Piancatelli rearrangement 2337:Liebeskind–Srogl coupling 2187:Fujimoto–Belleau reaction 1910: 1904:List of organic reactions 1768:Negative hyperconjugation 1513: 1455: 1002: 787:anthraquinone derivatives 677: 655: 556: 536: 531: 430: 410: 385: 106: 68: 56: 51: 42: 33: 24: 4672:Pictet–Spengler reaction 4587:Einhorn–Brunner reaction 4552:Boger pyridine synthesis 4446:Oxo-Diels–Alder reaction 4361:Aza-Diels–Alder reaction 4258:Pictet–Spengler reaction 4158:Hofmann–Löffler reaction 4148:Hegedus indole synthesis 4118:Fischer indole synthesis 3993:Bartoli indole synthesis 3948:Willgerodt rearrangement 3778:McLafferty rearrangement 3688:Ferrier carbocyclization 3503:2,3-Wittig rearrangement 3493:1,2-Wittig rearrangement 3333:Parikh–Doering oxidation 3323:Oxygen rebound mechanism 2988:Adkins–Peterson reaction 2880:Yamaguchi esterification 2820:Hegedus indole synthesis 2785:Bartoli indole synthesis 2656:Bamford–Stevens reaction 2572:Weinreb ketone synthesis 2532:Stork enamine alkylation 2307:Knoevenagel condensation 2177:Ferrier carbocyclization 2067:Castro–Stephens coupling 1693:Hammett acidity function 1683:Free-energy relationship 1628:Curtin–Hammett principle 1613:Conformational isomerism 1246:10.15227/orgsyn.018.0015 1219:10.15227/orgsyn.018.0072 1192:10.15227/orgsyn.014.0004 1155:10.1002/14356007.a02_347 991:attacks in New Zealand. 969:9,10-dihydroxyanthracene 957:single electron transfer 614:Precautionary statements 4632:Knorr pyrrole synthesis 4567:Bucherer–Bergs reaction 4512:Allan–Robinson reaction 4491:Wagner-Jauregg reaction 4283:Ring-closing metathesis 4208:Larock indole synthesis 4188:Knorr pyrrole synthesis 4043:Bucherer–Bergs reaction 3908:Stieglitz rearrangement 3888:SkattebĂžl rearrangement 3858:Ring-closing metathesis 3718:Group transfer reaction 3683:Favorskii rearrangement 3623:Cornforth rearrangement 3553:Bamberger rearrangement 3458:Wolff–Kishner reduction 3278:Markó–Lam deoxygenation 3173:Fleming–Tamao oxidation 3168:Fischer–Tropsch process 2855:Oxymercuration reaction 2835:Knorr pyrrole synthesis 2661:Barton–Kellogg reaction 2567:Wagner-Jauregg reaction 2487:Ring-closing metathesis 2477:Reimer–Tiemann reaction 2467:Rauhut–Currier reaction 2382:Nef isocyanide reaction 2342:Malonic ester synthesis 2312:Knorr pyrrole synthesis 2247:High dilution principle 2182:Friedel–Crafts reaction 2117:Cross-coupling reaction 2042:Bucherer–Bergs reaction 2027:Blanc chloromethylation 2017:Blaise ketone synthesis 1992:Baylis–Hillman reaction 1987:Barton–Kellogg reaction 1962:Allan–Robinson reaction 1868:Woodward–Hoffmann rules 1603:Charge-transfer complex 1149:. Weinheim: Wiley-VCH. 838:Friedel-Crafts reaction 833:is the typical oxidant. 793:, pharmaceuticals, and 86:Anthracene-9,10-quinone 4597:Feist–Benary synthesis 4371:Bradsher cycloaddition 4341:4+4 Photocycloaddition 4298:Simmons–Smith reaction 4243:PaternĂČ–BĂŒchi reaction 4103:Feist–Benary synthesis 4093:Dieckmann condensation 3843:Pummerer rearrangement 3823:Oxy-Cope rearrangement 3798:Myers allene synthesis 3748:Jacobsen rearrangement 3663:Electrocyclic reaction 3638:Demjanov rearrangement 3593:Buchner ring expansion 3563:Beckmann rearrangement 3543:Aza-Cope rearrangement 3538:Arndt–Eistert reaction 3513:Alkyne zipper reaction 3433:Transfer hydrogenation 3408:Sharpless oxyamination 3383:Selenoxide elimination 3268:Lombardo methylenation 3193:Griesbaum coozonolysis 3103:Corey–Itsuno reduction 3078:Boyland–Sims oxidation 3018:Angeli–Rimini reaction 2666:Boord olefin synthesis 2610:Arndt–Eistert reaction 2602:Homologation reactions 2402:Nitro-Mannich reaction 2317:Kolbe–Schmitt reaction 2127:Cross-coupling partner 2047:Buchner ring expansion 1967:Arndt–Eistert reaction 1733:Kinetic isotope effect 1480:Rearrangement reaction 785:for papermaking. Many 4456:Pauson–Khand reaction 4293:Sharpless epoxidation 4248:Pechmann condensation 4128:FriedlĂ€nder synthesis 4078:Davis–Beirut reaction 3933:Wallach rearrangement 3903:Stevens rearrangement 3838:Pinacol rearrangement 3818:Overman rearrangement 3733:Hofmann rearrangement 3728:Hayashi rearrangement 3693:Ferrier rearrangement 3648:Dimroth rearrangement 3633:Curtius rearrangement 3628:Criegee rearrangement 3608:Claisen rearrangement 3598:Carroll rearrangement 3533:Amadori rearrangement 3523:Allylic rearrangement 3403:Sharpless epoxidation 3138:Dess–Martin oxidation 3063:Bohn–Schmidt reaction 2923:Hofmann rearrangement 2726:Kauffmann olefination 2649:Olefination reactions 2587:Wurtz–Fittig reaction 2422:Palladium–NHC complex 2302:Kauffmann olefination 2257:Homologation reaction 2107:Corey–House synthesis 2087:Claisen rearrangement 1883:Yukawa–Tsuno equation 1843:Swain–Lupton equation 1823:Spherical aromaticity 1758:Möbius–HĂŒckel concept 1543:Aromatic ring current 1505:Substitution reaction 1284:Anthraquinone Pulping 1120:10.1039/9781849733069 62:Anthracene-9,10-dione 4662:Paal–Knorr synthesis 4532:Barton–Zard reaction 4476:Staudinger synthesis 4426:Ketene cycloaddition 4396:Diels–Alder reaction 4376:Cheletropic reaction 4356:Alkyne trimerisation 4238:Paal–Knorr synthesis 4203:Kulinkovich reaction 4178:Jacobsen epoxidation 4098:Diels–Alder reaction 3893:Smiles rearrangement 3883:Sigmatropic reaction 3768:Lossen rearrangement 3618:Corey–Fuchs reaction 3583:Boekelheide reaction 3578:Bergmann degradation 3508:Achmatowicz reaction 3293:Methionine sulfoxide 3093:Clemmensen reduction 3053:Bergmann degradation 2983:Acyloin condensation 2948:Strecker degradation 2903:Bergmann degradation 2870:Ullmann condensation 2736:Peterson olefination 2711:Hydrazone iodination 2691:Elimination reaction 2592:Zincke–Suhl reaction 2512:Sonogashira coupling 2472:Reformatsky reaction 2432:Peterson olefination 2397:Nierenstein reaction 2327:Kulinkovich reaction 2142:Diels–Alder reaction 2102:Corey–Fuchs reaction 2082:Claisen condensation 1952:Alkyne trimerisation 1927:Acyloin condensation 1893:ÎŁ-bishomoaromaticity 1853:Thorpe–Ingold effect 1465:Elimination reaction 1259:Samp, J. C. (2008). 1046:2-Ethylanthraquinone 936:processes, like the 903:dihydroanthraquinone 901:Hydrogenation gives 864:Diels-Alder reaction 552:possible carcinogen 77:9,10-Anthracenedione 58:Preferred IUPAC name 4682:Prilezhaev reaction 4667:Pellizzari reaction 4346:(4+3) cycloaddition 4313:Van Leusen reaction 4288:Robinson annulation 4273:Pschorr cyclization 4268:Prilezhaev reaction 3998:Bergman cyclization 3953:Wolff rearrangement 3938:Weerman degradation 3828:Pericyclic reaction 3808:Neber rearrangement 3703:Fries rearrangement 3588:Brook rearrangement 3573:Bergman cyclization 3418:Staudinger reaction 3363:Rosenmund reduction 3353:Reductive amination 3318:Oppenauer oxidation 3108:Corey–Kim oxidation 3083:Cannizzaro reaction 2958:Weerman degradation 2933:Isosaccharinic acid 2845:Mukaiyama hydration 2701:Hofmann elimination 2686:Dehydrohalogenation 2671:Chugaev elimination 2492:Robinson annulation 2437:Pfitzinger reaction 2207:Gattermann reaction 2152:Wulff–Dötz reaction 2132:Dakin–West reaction 2057:Carbonyl allylation 2002:Bergman cyclization 1788:Kennedy J. P. Orton 1708:Hammond's postulate 1678:Flippin–Lodge angle 1648:Electromeric effect 1573:Beta-silicon effect 1558:Baker–Nathan effect 522:Solubility in water 473: g·mol 160:Beilstein Reference 21: 20:9,10-Anthraquinone 4431:McCormack reaction 4381:Conia-ene reaction 4213:Madelung synthesis 4003:Biginelli reaction 3793:Mumm rearrangement 3678:Favorskii reaction 3613:Cope rearrangement 3603:Chan rearrangement 3368:Rubottom oxidation 3298:Miyaura borylation 3263:Lipid peroxidation 3258:Lindgren oxidation 3238:Kornblum oxidation 3233:Kolbe electrolysis 3178:Fukuyama reduction 3088:Carbonyl reduction 2938:Marker degradation 2800:Diazonium compound 2790:Boudouard reaction 2769:Carbon-heteroatom 2696:Grieco elimination 2482:Rieche formylation 2427:Passerini reaction 2357:Meerwein arylation 2277:Hydroxymethylation 2172:Favorskii reaction 2072:Chan rearrangement 2007:Biginelli reaction 1932:Aldol condensation 1778:2-Norbornyl cation 1753:Möbius aromaticity 1748:Markovnikov's rule 1643:Effective molarity 1588:BĂŒrgi–Dunitz angle 1578:Bicycloaromaticity 846:phthalic anhydride 710:Infobox references 656:Related compounds 19: 4723: 4722: 4719: 4718: 4715: 4714: 4707:Wohl–Aue reaction 4351:6+4 Cycloaddition 4168:Iodolactonization 3488:1,2-rearrangement 3453:Wohl–Aue reaction 3373:Sabatier reaction 3338:Pinnick oxidation 3303:Mozingo reduction 3248:Leuckart reaction 3203:Haloform reaction 3118:Criegee oxidation 3098:Collins oxidation 3048:Benkeser reaction 3043:Bechamp reduction 3013:Andrussow process 2998:Alcohol oxidation 2908:Edman degradation 2815:Haloform reaction 2764: 2763: 2751:Takai olefination 2716:Julia olefination 2542:Takai olefination 2417:Olefin metathesis 2292:Julia olefination 2217:Grignard reaction 2197:Fukuyama coupling 2112:Coupling reaction 2077:Chan–Lam coupling 1947:Alkyne metathesis 1942:Alkane metathesis 1798:Phosphaethynolate 1703:George S. Hammond 1663:Electronic effect 1618:Conjugated system 1500:Stereospecificity 1495:Stereoselectivity 1460:Addition reaction 1449:organic reactions 1338:Sunday Star Times 1234:Organic Syntheses 1207:Organic Syntheses 1180:Organic Syntheses 1129:978-0-85404-182-4 1078:(97th ed.). 825:The oxidation of 718:Chemical compound 716: 715: 662:Related compounds 600:Hazard statements 354:CompTox Dashboard 148:Interactive image 83:9,10-Anthrachinon 4743: 4702:Wenker synthesis 4692:StollĂ© synthesis 4547:Bobbitt reaction 4517:Auwers synthesis 4461:Povarov reaction 4386:Cyclopropanation 4324: 4323: 4318:Wenker synthesis 4073:Darzens reaction 4023:Bobbitt reaction 3868:Schmidt reaction 3673:Enyne metathesis 3448:Whiting reaction 3443:Wharton reaction 3388:Shapiro reaction 3378:Sarett oxidation 3343:PrĂ©vost reaction 3153:Emde degradation 2963:Wohl degradation 2943:Ruff degradation 2913:Emde degradation 2810:Grignard reagent 2746:Shapiro reaction 2731:McMurry reaction 2598: 2597: 2562:Ullmann reaction 2527:StollĂ© synthesis 2517:Stetter reaction 2507:Shapiro reaction 2497:Sakurai reaction 2392:Negishi coupling 2372:Minisci reaction 2367:Michael reaction 2352:McMurry reaction 2347:Mannich reaction 2227:Hammick reaction 2222:Grignard reagent 2162:Enyne metathesis 2147:Doebner reaction 2137:Darzens reaction 1982:Barbier reaction 1972:Auwers synthesis 1899: 1898: 1873:Woodward's rules 1838:Superaromaticity 1828:Spiroaromaticity 1728:Inductive effect 1723:Hyperconjugation 1698:Hammett equation 1638:Edwards equation 1490:Regioselectivity 1441: 1434: 1427: 1418: 1417: 1394: 1393: 1383: 1374:(5): 3257–3261. 1365: 1356: 1350: 1349: 1347: 1345: 1329: 1323: 1322: 1320: 1319: 1310:. Archived from 1304: 1298: 1297: 1279: 1273: 1272: 1256: 1250: 1249: 1229: 1223: 1222: 1202: 1196: 1195: 1175: 1169: 1168: 1140: 1134: 1133: 1100: 1094: 1093: 1082:. p. 3.28. 1069: 768: 767: 766: 758: 757: 749: 748: 737:organic compound 700: 694: 691: 690: 641: 637: 633: 629: 625: 621: 607: 579: 494: 472: 457: 451: 445: 438:Chemical formula 378: 377: 362: 360: 334: 298: 287: 273: 251:Gmelin Reference 244: 233: 222: 202: 182: 150: 126: 47: 38: 29: 22: 18: 4751: 4750: 4746: 4745: 4744: 4742: 4741: 4740: 4726: 4725: 4724: 4711: 4612:Gewald reaction 4495: 4322: 4303:Skraup reaction 4138:Graham reaction 4133:Gewald reaction 3964: 3957: 3479: 3472: 3428:Swern oxidation 3413:Stahl oxidation 3358:Riley oxidation 3313:Omega oxidation 3273:Luche reduction 3223:Jones oxidation 3188:Glycol cleavage 3183:Ganem oxidation 3128:Davis oxidation 3123:Dakin oxidation 3058:Birch reduction 3008:Amide reduction 2974: 2967: 2928:Hooker reaction 2890: 2884: 2772: 2770: 2760: 2756:Wittig reaction 2644: 2640:Wittig reaction 2615:Hooker reaction 2596: 2577:Wittig reaction 2552:Thorpe reaction 2537:Suzuki reaction 2522:Stille reaction 2457:Quelet reaction 2332:Kumada coupling 2282:Ivanov reaction 2272:Hydrovinylation 2252:Hiyama coupling 2212:Glaser coupling 2022:Blaise reaction 2012:Bingel reaction 1997:Benary reaction 1914: 1912: 1906: 1897: 1793:Passive binding 1713:Homoaromaticity 1563:Baldwin's rules 1538:Antiaromaticity 1533:Anomeric effect 1509: 1451: 1445: 1403: 1398: 1397: 1363: 1357: 1353: 1343: 1341: 1330: 1326: 1317: 1315: 1306: 1305: 1301: 1294: 1280: 1276: 1257: 1253: 1230: 1226: 1203: 1199: 1176: 1172: 1165: 1141: 1137: 1130: 1114:. p. 724. 1101: 1097: 1090: 1070: 1059: 1054: 1027: 1012: 1005: 997: 985: 940:, the alkaline 926: 921: 915: 899: 853: 848:in presence of 819: 765: 762: 761: 760: 756: 753: 752: 751: 747: 744: 743: 742: 740: 730:dioxoanthracene 726:anthracenedione 719: 712: 707: 706: 705:  ?) 696: 692: 688: 684: 670: 663: 616: 602: 588: 572: 549: 524: 492: 470: 460: 454: 448: 440: 426: 423: 418: 417: 406: 403: 402: 399: 393: 392: 381: 363: 356: 337: 317: 301: 288: 276: 253: 225: 205: 185: 162: 153: 140: 129: 116: 102: 101: 64: 63: 17: 12: 11: 5: 4749: 4739: 4738: 4736:Anthraquinones 4721: 4720: 4717: 4716: 4713: 4712: 4710: 4709: 4704: 4699: 4694: 4689: 4684: 4679: 4674: 4669: 4664: 4659: 4654: 4649: 4644: 4639: 4634: 4629: 4624: 4619: 4617:Hantzsch ester 4614: 4609: 4604: 4599: 4594: 4589: 4584: 4579: 4574: 4569: 4564: 4559: 4554: 4549: 4544: 4539: 4534: 4529: 4527:Banert cascade 4524: 4519: 4514: 4509: 4503: 4501: 4497: 4496: 4494: 4493: 4488: 4483: 4478: 4473: 4468: 4466:Prato reaction 4463: 4458: 4453: 4448: 4443: 4438: 4433: 4428: 4423: 4418: 4413: 4408: 4403: 4398: 4393: 4388: 4383: 4378: 4373: 4368: 4363: 4358: 4353: 4348: 4343: 4338: 4332: 4330: 4321: 4320: 4315: 4310: 4305: 4300: 4295: 4290: 4285: 4280: 4275: 4270: 4265: 4260: 4255: 4250: 4245: 4240: 4235: 4230: 4225: 4220: 4215: 4210: 4205: 4200: 4195: 4190: 4185: 4180: 4175: 4170: 4165: 4160: 4155: 4150: 4145: 4140: 4135: 4130: 4125: 4120: 4115: 4110: 4105: 4100: 4095: 4090: 4085: 4080: 4075: 4070: 4065: 4060: 4055: 4050: 4045: 4040: 4035: 4030: 4025: 4020: 4015: 4010: 4005: 4000: 3995: 3990: 3985: 3980: 3975: 3969: 3967: 3959: 3958: 3956: 3955: 3950: 3945: 3940: 3935: 3930: 3925: 3920: 3915: 3910: 3905: 3900: 3895: 3890: 3885: 3880: 3875: 3870: 3865: 3860: 3855: 3850: 3845: 3840: 3835: 3830: 3825: 3820: 3815: 3810: 3805: 3800: 3795: 3790: 3785: 3780: 3775: 3770: 3765: 3760: 3755: 3750: 3745: 3740: 3735: 3730: 3725: 3720: 3715: 3710: 3705: 3700: 3695: 3690: 3685: 3680: 3675: 3670: 3665: 3660: 3655: 3650: 3645: 3640: 3635: 3630: 3625: 3620: 3615: 3610: 3605: 3600: 3595: 3590: 3585: 3580: 3575: 3570: 3565: 3560: 3558:Banert cascade 3555: 3550: 3545: 3540: 3535: 3530: 3525: 3520: 3515: 3510: 3505: 3500: 3495: 3490: 3484: 3482: 3478:Rearrangement 3474: 3473: 3471: 3470: 3468:Zinin reaction 3465: 3460: 3455: 3450: 3445: 3440: 3438:Wacker process 3435: 3430: 3425: 3420: 3415: 3410: 3405: 3400: 3395: 3390: 3385: 3380: 3375: 3370: 3365: 3360: 3355: 3350: 3345: 3340: 3335: 3330: 3325: 3320: 3315: 3310: 3305: 3300: 3295: 3290: 3285: 3280: 3275: 3270: 3265: 3260: 3255: 3250: 3245: 3240: 3235: 3230: 3225: 3220: 3215: 3213:Hydrogenolysis 3210: 3205: 3200: 3195: 3190: 3185: 3180: 3175: 3170: 3165: 3163:Étard reaction 3160: 3155: 3150: 3145: 3140: 3135: 3130: 3125: 3120: 3115: 3110: 3105: 3100: 3095: 3090: 3085: 3080: 3075: 3070: 3068:Bosch reaction 3065: 3060: 3055: 3050: 3045: 3040: 3035: 3030: 3025: 3020: 3015: 3010: 3005: 3000: 2995: 2990: 2985: 2979: 2977: 2973:Organic redox 2969: 2968: 2966: 2965: 2960: 2955: 2950: 2945: 2940: 2935: 2930: 2925: 2920: 2915: 2910: 2905: 2900: 2894: 2892: 2886: 2885: 2883: 2882: 2877: 2872: 2867: 2862: 2857: 2852: 2847: 2842: 2837: 2832: 2827: 2822: 2817: 2812: 2807: 2805:Esterification 2802: 2797: 2792: 2787: 2782: 2776: 2774: 2766: 2765: 2762: 2761: 2759: 2758: 2753: 2748: 2743: 2738: 2733: 2728: 2723: 2718: 2713: 2708: 2703: 2698: 2693: 2688: 2683: 2678: 2673: 2668: 2663: 2658: 2652: 2650: 2646: 2645: 2643: 2642: 2637: 2632: 2627: 2622: 2617: 2612: 2606: 2604: 2595: 2594: 2589: 2584: 2582:Wurtz reaction 2579: 2574: 2569: 2564: 2559: 2554: 2549: 2544: 2539: 2534: 2529: 2524: 2519: 2514: 2509: 2504: 2499: 2494: 2489: 2484: 2479: 2474: 2469: 2464: 2459: 2454: 2452:Prins reaction 2449: 2444: 2439: 2434: 2429: 2424: 2419: 2414: 2409: 2404: 2399: 2394: 2389: 2384: 2379: 2374: 2369: 2364: 2359: 2354: 2349: 2344: 2339: 2334: 2329: 2324: 2319: 2314: 2309: 2304: 2299: 2294: 2289: 2284: 2279: 2274: 2269: 2267:Hydrocyanation 2264: 2259: 2254: 2249: 2244: 2239: 2237:Henry reaction 2234: 2229: 2224: 2219: 2214: 2209: 2204: 2199: 2194: 2189: 2184: 2179: 2174: 2169: 2164: 2159: 2154: 2149: 2144: 2139: 2134: 2129: 2124: 2119: 2114: 2109: 2104: 2099: 2094: 2089: 2084: 2079: 2074: 2069: 2064: 2059: 2054: 2049: 2044: 2039: 2034: 2029: 2024: 2019: 2014: 2009: 2004: 1999: 1994: 1989: 1984: 1979: 1974: 1969: 1964: 1959: 1954: 1949: 1944: 1939: 1937:Aldol reaction 1934: 1929: 1924: 1918: 1916: 1911:Carbon-carbon 1908: 1907: 1896: 1895: 1890: 1888:Zaitsev's rule 1885: 1880: 1875: 1870: 1865: 1860: 1855: 1850: 1845: 1840: 1835: 1833:Steric effects 1830: 1825: 1820: 1815: 1810: 1805: 1800: 1795: 1790: 1785: 1780: 1775: 1770: 1765: 1760: 1755: 1750: 1745: 1740: 1735: 1730: 1725: 1720: 1715: 1710: 1705: 1700: 1695: 1690: 1685: 1680: 1675: 1670: 1665: 1660: 1655: 1650: 1645: 1640: 1635: 1630: 1625: 1620: 1615: 1610: 1605: 1600: 1595: 1590: 1585: 1580: 1575: 1570: 1565: 1560: 1555: 1550: 1545: 1540: 1535: 1530: 1525: 1520: 1514: 1511: 1510: 1508: 1507: 1502: 1497: 1492: 1487: 1485:Redox reaction 1482: 1477: 1472: 1470:Polymerization 1467: 1462: 1456: 1453: 1452: 1444: 1443: 1436: 1429: 1421: 1415: 1414: 1409: 1402: 1401:External links 1399: 1396: 1395: 1351: 1324: 1299: 1292: 1274: 1251: 1224: 1197: 1170: 1164:978-3527306732 1163: 1135: 1128: 1095: 1088: 1056: 1055: 1053: 1050: 1049: 1048: 1043: 1038: 1036:Naphthoquinone 1033: 1026: 1023: 1010: 1004: 1001: 996: 993: 984: 981: 925: 922: 919:Anthraquinones 914: 911: 898: 895: 887: 886: 875: 868:naphthoquinone 860: 857:anthraquinones 851: 834: 818: 815: 763: 754: 745: 724:, also called 717: 714: 713: 708: 686: 685: 681:standard state 678: 675: 674: 664: 661: 658: 657: 653: 652: 649: 643: 642: 617: 612: 609: 608: 603: 598: 595: 594: 589: 584: 581: 580: 573: 568: 565: 564: 554: 553: 550: 547: 544: 543: 534: 533: 529: 528: 525: 520: 517: 516: 513: 507: 506: 503: 497: 496: 489: 483: 482: 479: 475: 474: 468: 462: 461: 458: 452: 446: 441: 436: 433: 432: 428: 427: 425: 424: 421: 413: 412: 411: 408: 407: 405: 404: 400: 397: 396: 388: 387: 386: 383: 382: 380: 379: 366: 364: 352: 349: 348: 345: 339: 338: 336: 335: 327: 325: 319: 318: 316: 315: 311: 309: 303: 302: 300: 299: 291: 289: 281: 278: 277: 275: 274: 266: 264: 258: 257: 254: 249: 246: 245: 235: 227: 226: 224: 223: 215: 213: 207: 206: 204: 203: 195: 193: 187: 186: 184: 183: 175: 173: 167: 166: 163: 158: 155: 154: 152: 151: 143: 141: 134: 131: 130: 128: 127: 119: 117: 112: 109: 108: 104: 103: 100: 99: 96: 93: 90: 87: 84: 81: 78: 75: 71: 70: 66: 65: 61: 60: 54: 53: 49: 48: 40: 39: 31: 30: 15: 9: 6: 4: 3: 2: 4748: 4737: 4734: 4733: 4731: 4708: 4705: 4703: 4700: 4698: 4695: 4693: 4690: 4688: 4685: 4683: 4680: 4678: 4675: 4673: 4670: 4668: 4665: 4663: 4660: 4658: 4655: 4653: 4650: 4648: 4645: 4643: 4640: 4638: 4635: 4633: 4630: 4628: 4627:Herz reaction 4625: 4623: 4620: 4618: 4615: 4613: 4610: 4608: 4605: 4603: 4600: 4598: 4595: 4593: 4590: 4588: 4585: 4583: 4580: 4578: 4575: 4573: 4570: 4568: 4565: 4563: 4560: 4558: 4555: 4553: 4550: 4548: 4545: 4543: 4540: 4538: 4535: 4533: 4530: 4528: 4525: 4523: 4520: 4518: 4515: 4513: 4510: 4508: 4505: 4504: 4502: 4498: 4492: 4489: 4487: 4484: 4482: 4479: 4477: 4474: 4472: 4469: 4467: 4464: 4462: 4459: 4457: 4454: 4452: 4449: 4447: 4444: 4442: 4439: 4437: 4434: 4432: 4429: 4427: 4424: 4422: 4419: 4417: 4414: 4412: 4409: 4407: 4404: 4402: 4399: 4397: 4394: 4392: 4389: 4387: 4384: 4382: 4379: 4377: 4374: 4372: 4369: 4367: 4364: 4362: 4359: 4357: 4354: 4352: 4349: 4347: 4344: 4342: 4339: 4337: 4334: 4333: 4331: 4329: 4328:Cycloaddition 4325: 4319: 4316: 4314: 4311: 4309: 4306: 4304: 4301: 4299: 4296: 4294: 4291: 4289: 4286: 4284: 4281: 4279: 4276: 4274: 4271: 4269: 4266: 4264: 4261: 4259: 4256: 4254: 4251: 4249: 4246: 4244: 4241: 4239: 4236: 4234: 4231: 4229: 4226: 4224: 4221: 4219: 4216: 4214: 4211: 4209: 4206: 4204: 4201: 4199: 4196: 4194: 4191: 4189: 4186: 4184: 4181: 4179: 4176: 4174: 4173:Isay reaction 4171: 4169: 4166: 4164: 4161: 4159: 4156: 4154: 4151: 4149: 4146: 4144: 4141: 4139: 4136: 4134: 4131: 4129: 4126: 4124: 4121: 4119: 4116: 4114: 4111: 4109: 4106: 4104: 4101: 4099: 4096: 4094: 4091: 4089: 4086: 4084: 4081: 4079: 4076: 4074: 4071: 4069: 4068:Cycloaddition 4066: 4064: 4061: 4059: 4056: 4054: 4051: 4049: 4046: 4044: 4041: 4039: 4036: 4034: 4031: 4029: 4026: 4024: 4021: 4019: 4016: 4014: 4011: 4009: 4006: 4004: 4001: 3999: 3996: 3994: 3991: 3989: 3986: 3984: 3981: 3979: 3976: 3974: 3971: 3970: 3968: 3966: 3963:Ring forming 3960: 3954: 3951: 3949: 3946: 3944: 3941: 3939: 3936: 3934: 3931: 3929: 3926: 3924: 3921: 3919: 3916: 3914: 3911: 3909: 3906: 3904: 3901: 3899: 3896: 3894: 3891: 3889: 3886: 3884: 3881: 3879: 3876: 3874: 3871: 3869: 3866: 3864: 3863:Rupe reaction 3861: 3859: 3856: 3854: 3851: 3849: 3846: 3844: 3841: 3839: 3836: 3834: 3831: 3829: 3826: 3824: 3821: 3819: 3816: 3814: 3811: 3809: 3806: 3804: 3801: 3799: 3796: 3794: 3791: 3789: 3786: 3784: 3781: 3779: 3776: 3774: 3771: 3769: 3766: 3764: 3761: 3759: 3756: 3754: 3751: 3749: 3746: 3744: 3741: 3739: 3736: 3734: 3731: 3729: 3726: 3724: 3721: 3719: 3716: 3714: 3711: 3709: 3706: 3704: 3701: 3699: 3696: 3694: 3691: 3689: 3686: 3684: 3681: 3679: 3676: 3674: 3671: 3669: 3666: 3664: 3661: 3659: 3656: 3654: 3651: 3649: 3646: 3644: 3641: 3639: 3636: 3634: 3631: 3629: 3626: 3624: 3621: 3619: 3616: 3614: 3611: 3609: 3606: 3604: 3601: 3599: 3596: 3594: 3591: 3589: 3586: 3584: 3581: 3579: 3576: 3574: 3571: 3569: 3566: 3564: 3561: 3559: 3556: 3554: 3551: 3549: 3546: 3544: 3541: 3539: 3536: 3534: 3531: 3529: 3526: 3524: 3521: 3519: 3516: 3514: 3511: 3509: 3506: 3504: 3501: 3499: 3496: 3494: 3491: 3489: 3486: 3485: 3483: 3481: 3475: 3469: 3466: 3464: 3461: 3459: 3456: 3454: 3451: 3449: 3446: 3444: 3441: 3439: 3436: 3434: 3431: 3429: 3426: 3424: 3421: 3419: 3416: 3414: 3411: 3409: 3406: 3404: 3401: 3399: 3396: 3394: 3391: 3389: 3386: 3384: 3381: 3379: 3376: 3374: 3371: 3369: 3366: 3364: 3361: 3359: 3356: 3354: 3351: 3349: 3346: 3344: 3341: 3339: 3336: 3334: 3331: 3329: 3326: 3324: 3321: 3319: 3316: 3314: 3311: 3309: 3306: 3304: 3301: 3299: 3296: 3294: 3291: 3289: 3286: 3284: 3281: 3279: 3276: 3274: 3271: 3269: 3266: 3264: 3261: 3259: 3256: 3254: 3253:Ley oxidation 3251: 3249: 3246: 3244: 3241: 3239: 3236: 3234: 3231: 3229: 3226: 3224: 3221: 3219: 3218:Hydroxylation 3216: 3214: 3211: 3209: 3208:Hydrogenation 3206: 3204: 3201: 3199: 3196: 3194: 3191: 3189: 3186: 3184: 3181: 3179: 3176: 3174: 3171: 3169: 3166: 3164: 3161: 3159: 3156: 3154: 3151: 3149: 3146: 3144: 3143:DNA oxidation 3141: 3139: 3136: 3134: 3133:Deoxygenation 3131: 3129: 3126: 3124: 3121: 3119: 3116: 3114: 3111: 3109: 3106: 3104: 3101: 3099: 3096: 3094: 3091: 3089: 3086: 3084: 3081: 3079: 3076: 3074: 3071: 3069: 3066: 3064: 3061: 3059: 3056: 3054: 3051: 3049: 3046: 3044: 3041: 3039: 3036: 3034: 3031: 3029: 3026: 3024: 3023:Aromatization 3021: 3019: 3016: 3014: 3011: 3009: 3006: 3004: 3001: 2999: 2996: 2994: 2991: 2989: 2986: 2984: 2981: 2980: 2978: 2976: 2970: 2964: 2961: 2959: 2956: 2954: 2951: 2949: 2946: 2944: 2941: 2939: 2936: 2934: 2931: 2929: 2926: 2924: 2921: 2919: 2916: 2914: 2911: 2909: 2906: 2904: 2901: 2899: 2896: 2895: 2893: 2887: 2881: 2878: 2876: 2873: 2871: 2868: 2866: 2863: 2861: 2860:Reed reaction 2858: 2856: 2853: 2851: 2848: 2846: 2843: 2841: 2838: 2836: 2833: 2831: 2828: 2826: 2823: 2821: 2818: 2816: 2813: 2811: 2808: 2806: 2803: 2801: 2798: 2796: 2793: 2791: 2788: 2786: 2783: 2781: 2778: 2777: 2775: 2771:bond forming 2767: 2757: 2754: 2752: 2749: 2747: 2744: 2742: 2739: 2737: 2734: 2732: 2729: 2727: 2724: 2722: 2719: 2717: 2714: 2712: 2709: 2707: 2704: 2702: 2699: 2697: 2694: 2692: 2689: 2687: 2684: 2682: 2679: 2677: 2676:Cope reaction 2674: 2672: 2669: 2667: 2664: 2662: 2659: 2657: 2654: 2653: 2651: 2647: 2641: 2638: 2636: 2633: 2631: 2628: 2626: 2623: 2621: 2618: 2616: 2613: 2611: 2608: 2607: 2605: 2603: 2599: 2593: 2590: 2588: 2585: 2583: 2580: 2578: 2575: 2573: 2570: 2568: 2565: 2563: 2560: 2558: 2555: 2553: 2550: 2548: 2545: 2543: 2540: 2538: 2535: 2533: 2530: 2528: 2525: 2523: 2520: 2518: 2515: 2513: 2510: 2508: 2505: 2503: 2500: 2498: 2495: 2493: 2490: 2488: 2485: 2483: 2480: 2478: 2475: 2473: 2470: 2468: 2465: 2463: 2460: 2458: 2455: 2453: 2450: 2448: 2445: 2443: 2440: 2438: 2435: 2433: 2430: 2428: 2425: 2423: 2420: 2418: 2415: 2413: 2410: 2408: 2405: 2403: 2400: 2398: 2395: 2393: 2390: 2388: 2387:Nef synthesis 2385: 2383: 2380: 2378: 2375: 2373: 2370: 2368: 2365: 2363: 2362:Methylenation 2360: 2358: 2355: 2353: 2350: 2348: 2345: 2343: 2340: 2338: 2335: 2333: 2330: 2328: 2325: 2323: 2320: 2318: 2315: 2313: 2310: 2308: 2305: 2303: 2300: 2298: 2295: 2293: 2290: 2288: 2285: 2283: 2280: 2278: 2275: 2273: 2270: 2268: 2265: 2263: 2260: 2258: 2255: 2253: 2250: 2248: 2245: 2243: 2240: 2238: 2235: 2233: 2232:Heck reaction 2230: 2228: 2225: 2223: 2220: 2218: 2215: 2213: 2210: 2208: 2205: 2203: 2200: 2198: 2195: 2193: 2190: 2188: 2185: 2183: 2180: 2178: 2175: 2173: 2170: 2168: 2165: 2163: 2160: 2158: 2155: 2153: 2150: 2148: 2145: 2143: 2140: 2138: 2135: 2133: 2130: 2128: 2125: 2123: 2120: 2118: 2115: 2113: 2110: 2108: 2105: 2103: 2100: 2098: 2095: 2093: 2090: 2088: 2085: 2083: 2080: 2078: 2075: 2073: 2070: 2068: 2065: 2063: 2060: 2058: 2055: 2053: 2050: 2048: 2045: 2043: 2040: 2038: 2035: 2033: 2030: 2028: 2025: 2023: 2020: 2018: 2015: 2013: 2010: 2008: 2005: 2003: 2000: 1998: 1995: 1993: 1990: 1988: 1985: 1983: 1980: 1978: 1975: 1973: 1970: 1968: 1965: 1963: 1960: 1958: 1955: 1953: 1950: 1948: 1945: 1943: 1940: 1938: 1935: 1933: 1930: 1928: 1925: 1923: 1920: 1919: 1917: 1913:bond forming 1909: 1905: 1900: 1894: 1891: 1889: 1886: 1884: 1881: 1879: 1878:Y-aromaticity 1876: 1874: 1871: 1869: 1866: 1864: 1863:Walsh diagram 1861: 1859: 1856: 1854: 1851: 1849: 1848:Taft equation 1846: 1844: 1841: 1839: 1836: 1834: 1831: 1829: 1826: 1824: 1821: 1819: 1818:ÎŁ-aromaticity 1816: 1814: 1811: 1809: 1806: 1804: 1801: 1799: 1796: 1794: 1791: 1789: 1786: 1784: 1781: 1779: 1776: 1774: 1771: 1769: 1766: 1764: 1761: 1759: 1756: 1754: 1751: 1749: 1746: 1744: 1743:Marcus theory 1741: 1739: 1736: 1734: 1731: 1729: 1726: 1724: 1721: 1719: 1718:HĂŒckel's rule 1716: 1714: 1711: 1709: 1706: 1704: 1701: 1699: 1696: 1694: 1691: 1689: 1686: 1684: 1681: 1679: 1676: 1674: 1673:Evelyn effect 1671: 1669: 1666: 1664: 1661: 1659: 1656: 1654: 1653:Electron-rich 1651: 1649: 1646: 1644: 1641: 1639: 1636: 1634: 1631: 1629: 1626: 1624: 1621: 1619: 1616: 1614: 1611: 1609: 1606: 1604: 1601: 1599: 1596: 1594: 1591: 1589: 1586: 1584: 1581: 1579: 1576: 1574: 1571: 1569: 1568:Bema Hapothle 1566: 1564: 1561: 1559: 1556: 1554: 1551: 1549: 1546: 1544: 1541: 1539: 1536: 1534: 1531: 1529: 1526: 1524: 1521: 1519: 1516: 1515: 1512: 1506: 1503: 1501: 1498: 1496: 1493: 1491: 1488: 1486: 1483: 1481: 1478: 1476: 1473: 1471: 1468: 1466: 1463: 1461: 1458: 1457: 1454: 1450: 1442: 1437: 1435: 1430: 1428: 1423: 1422: 1419: 1413: 1410: 1408: 1405: 1404: 1391: 1387: 1382: 1377: 1373: 1369: 1362: 1355: 1340:. New Zealand 1339: 1335: 1328: 1314:on 2009-06-09 1313: 1309: 1303: 1295: 1293:0-89852-340-0 1289: 1285: 1278: 1270: 1266: 1262: 1255: 1247: 1243: 1239: 1235: 1228: 1220: 1216: 1212: 1208: 1201: 1193: 1189: 1185: 1181: 1174: 1166: 1160: 1156: 1152: 1148: 1147: 1139: 1131: 1125: 1121: 1117: 1113: 1109: 1105: 1099: 1091: 1089:9781498754293 1085: 1081: 1077: 1076: 1068: 1066: 1064: 1062: 1057: 1047: 1044: 1042: 1039: 1037: 1034: 1032: 1029: 1028: 1022: 1020: 1015: 1013: 1000: 995:Other isomers 992: 990: 980: 978: 974: 970: 966: 965:hemicellulose 962: 958: 954: 951: 947: 943: 939: 935: 931: 920: 910: 908: 904: 894: 892: 884: 880: 876: 873: 869: 865: 861: 858: 854: 847: 843: 839: 835: 832: 828: 824: 823: 822: 814: 812: 808: 804: 800: 796: 792: 788: 784: 780: 776: 772: 739:with formula 738: 735: 731: 727: 723: 722:Anthraquinone 711: 704: 699: 682: 676: 673: 668: 665: 660: 659: 654: 650: 648: 645: 644: 618: 615: 611: 610: 604: 601: 597: 596: 593: 590: 587: 583: 582: 578: 574: 571: 567: 566: 562: 560: 555: 551: 546: 545: 541: 540: 535: 530: 526: 523: 519: 518: 514: 512: 511:Boiling point 509: 508: 504: 502: 501:Melting point 499: 498: 490: 488: 485: 484: 481:Yellow solid 480: 477: 476: 469: 467: 464: 463: 442: 439: 435: 434: 429: 420: 419: 416: 409: 395: 394: 391: 384: 376: 372: 371:DTXSID3020095 368: 367: 365: 355: 351: 350: 346: 344: 341: 340: 333: 329: 328: 326: 324: 321: 320: 313: 312: 310: 308: 305: 304: 297: 293: 292: 290: 284: 280: 279: 272: 268: 267: 265: 263: 260: 259: 255: 252: 248: 247: 243: 239: 236: 234: 232:ECHA InfoCard 229: 228: 221: 217: 216: 214: 212: 209: 208: 201: 197: 196: 194: 192: 189: 188: 181: 177: 176: 174: 172: 169: 168: 164: 161: 157: 156: 149: 145: 144: 142: 138: 133: 132: 125: 121: 120: 118: 115: 111: 110: 105: 97: 94: 91: 88: 85: 82: 79: 76: 74:Anthraquinone 73: 72: 67: 59: 55: 50: 46: 41: 37: 32: 28: 23: 3668:Ene reaction 3028:Autoxidation 2889:Degradation 2780:Azo coupling 2557:Ugi reaction 2157:Ene reaction 1957:Alkynylation 1808:Polyfluorene 1803:Polar effect 1668:Electrophile 1583:Bredt's rule 1553:Baird's rule 1523:Alpha effect 1371: 1367: 1354: 1342:. Retrieved 1337: 1327: 1316:. Retrieved 1312:the original 1302: 1283: 1277: 1260: 1254: 1237: 1233: 1227: 1210: 1206: 1200: 1183: 1179: 1173: 1144: 1138: 1107: 1098: 1073: 1031:Benzoquinone 1016: 1006: 998: 986: 977:kappa number 927: 913:Applications 900: 888: 831:Chromium(VI) 820: 729: 725: 721: 720: 591: 558: 548:Main hazards 537: 307:RTECS number 107:Identifiers 69:Other names 2167:Ethenolysis 1813:Ring strain 1783:Nucleophile 1608:Clar's rule 1548:Aromaticity 1344:11 November 647:Flash point 586:Signal word 542:(OHS/OSH): 478:Appearance 431:Properties 238:100.001.408 200:ChEMBL55659 180:CHEBI:40448 80:Anthradione 4451:Ozonolysis 3978:Annulation 3328:Ozonolysis 1447:Topics in 1318:2009-09-22 1269:1853/24767 1052:References 983:Niche uses 930:paper pulp 917:See also: 827:anthracene 769:. Several 672:anthracene 570:Pictograms 527:Insoluble 466:Molar mass 332:030MS0JBDO 211:ChemSpider 135:3D model ( 114:CAS Number 3965:reactions 3480:reactions 2975:reactions 2891:reactions 2773:reactions 1915:reactions 1080:CRC Press 961:cellulose 897:Reactions 872:butadiene 817:Synthesis 795:catalysts 783:wood pulp 632:P308+P313 561:labelling 343:UN number 314:CB4725000 4730:Category 1858:Vinylogy 1528:Annulene 1475:Reagents 1106:(2014). 1041:Parietin 1025:See also 953:catalyst 934:alkaline 907:anthrone 734:aromatic 732:, is an 532:Hazards 1518:A value 1390:1339448 946:Soda-AQ 944:or the 942:sulfite 879:styrene 842:benzene 811:hoelite 807:ethanol 799:soluble 771:isomers 703:what is 701: ( 667:quinone 487:Density 471:208.216 283:PubChem 256:102870 165:390030 124:84-65-1 92:Hoelite 1388:  1290:  1240:: 15. 1213:: 72. 1161:  1126:  1086:  1019:UGT1A8 1003:Safety 973:lignin 698:verify 695:  592:Danger 493:  415:SMILES 271:C16207 191:ChEMBL 98:Corbit 95:Morkit 52:Names 1364:(PDF) 1186:: 4. 950:redox 938:kraft 803:water 775:IUPAC 495:g/cm 491:1.438 390:InChI 347:3143 171:ChEBI 137:JSmol 1386:PMID 1346:2014 1288:ISBN 1159:ISBN 1124:ISBN 1084:ISBN 963:and 883:BASF 870:and 862:The 850:AlCl 844:and 836:The 791:dyes 779:keto 640:P501 636:P405 628:P281 624:P202 620:P201 606:H350 323:UNII 296:6780 262:KEGG 220:6522 1376:doi 1372:267 1265:hdl 1242:doi 1215:doi 1188:doi 1151:doi 1116:doi 989:kea 932:by 866:of 840:of 801:in 728:or 559:GHS 359:EPA 286:CID 4732:: 1384:. 1370:. 1366:. 1336:. 1238:18 1236:. 1211:18 1209:. 1184:14 1182:. 1157:. 1122:. 1110:. 1060:^ 1011:50 1009:LD 979:. 893:. 829:. 813:. 746:14 638:, 634:, 630:, 626:, 622:, 563:: 447:14 1440:e 1433:t 1426:v 1392:. 1378:: 1348:. 1321:. 1296:. 1271:. 1267:: 1248:. 1244:: 1221:. 1217:: 1194:. 1190:: 1167:. 1153:: 1132:. 1118:: 1092:. 885:. 859:. 852:3 764:2 759:O 755:8 750:H 741:C 693:N 669:, 459:2 456:O 453:8 450:H 444:C 361:) 357:( 139:)

Index




Preferred IUPAC name
CAS Number
84-65-1
JSmol
Interactive image
Beilstein Reference
ChEBI
CHEBI:40448
ChEMBL
ChEMBL55659
ChemSpider
6522
ECHA InfoCard
100.001.408
Edit this at Wikidata
Gmelin Reference
KEGG
C16207
PubChem
6780
RTECS number
UNII
030MS0JBDO
UN number
CompTox Dashboard
DTXSID3020095
Edit this at Wikidata

Text is available under the Creative Commons Attribution-ShareAlike License. Additional terms may apply.

↑